CAS 164648-48-0

Urea, [4-(aminomethyl)phenyl]-

Description:

Urea, [4-(aminomethyl)phenyl]-, also known by its CAS number 164648-48-0, is an organic compound characterized by the presence of a urea functional group and an aminomethyl-substituted phenyl group. This compound typically exhibits properties associated with both amines and ureas, such as moderate solubility in polar solvents due to the presence of hydrogen-bonding capabilities. It may display basicity due to the amino group, which can accept protons. The structure suggests potential applications in pharmaceuticals or agrochemicals, as compounds with similar frameworks often serve as intermediates or active ingredients. Additionally, the presence of the phenyl ring may contribute to its stability and influence its reactivity. The compound's molecular interactions, including hydrogen bonding and potential for forming complexes, can also play a significant role in its behavior in various chemical environments. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards.

Formula: C₈H₁₁N₃O

InChI: InChI=1S/C8H11N3O/c9-5-6-1-3-7(4-2-6)11-8(10)12/h1-4H,5,9H2,(H3,10,11,12)

InChI key: InChIKey=NTXHODRGDRNTNY-UHFFFAOYSA-N

SMILES: N(C(N)=O)C1=CC=C(CN)C=C1

Synonyms:

• N-[4-(Aminomethyl)phenyl]urea
• [4-(Aminomethyl)phenyl]urea
• Urea, [4-(aminomethyl)phenyl]-
• Urea, N-[4-(aminomethyl)phenyl]-