CymitQuimica logo

CAS 164648-88-8

:

Benzenemethanamine, 4-amino-3-fluoro-

Description:
Benzenemethanamine, 4-amino-3-fluoro- is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with an amino group and a fluorine atom. The presence of the amino group (-NH2) indicates that it can act as a base and participate in various chemical reactions, such as nucleophilic substitutions. The fluorine atom, being highly electronegative, can influence the compound's reactivity and polarity, potentially enhancing its solubility in polar solvents. This compound is likely to exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds, which can affect its boiling and melting points. Additionally, the specific arrangement of substituents on the benzene ring can lead to unique steric and electronic effects, influencing its behavior in chemical reactions and interactions with biological systems. Overall, Benzenemethanamine, 4-amino-3-fluoro- is a compound of interest in various fields, including pharmaceuticals and materials science, due to its potential applications and reactivity.
Formula:C7H9FN2
InChI:InChI=1S/C7H9FN2/c8-6-3-5(4-9)1-2-7(6)10/h1-3H,4,9-10H2
InChI key:YSXWSLITLDXLCG-UHFFFAOYSA-N
SMILES:C1=CC(=C(C=C1CN)F)N
Found 4 products.