CAS 164658-13-3: 3-[(4-{2-[(3-chlorophenyl)amino]pyrimidin-4-yl}pyridin-2-yl)amino]propan-1-ol
Description:The chemical substance known as 3-[(4-{2-[(3-chlorophenyl)amino]pyrimidin-4-yl}pyridin-2-yl)amino]propan-1-ol, with the CAS number 164658-13-3, is a complex organic compound characterized by its multi-ring structure and the presence of various functional groups. It features a propanol backbone, which contributes to its potential solubility in polar solvents. The compound contains a pyrimidine and a pyridine ring, both of which are nitrogen-containing heterocycles, enhancing its biological activity and potential as a pharmaceutical agent. The presence of a chlorophenyl group suggests possible interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the amino groups in the structure may facilitate hydrogen bonding, influencing its reactivity and interaction with other molecules. Overall, this compound's intricate structure and functional groups suggest it may exhibit significant pharmacological properties, warranting further investigation in drug development and therapeutic applications.
Formula:C18H18ClN5O
InChI:InChI=1/C18H18ClN5O/c19-14-3-1-4-15(12-14)23-18-22-9-6-16(24-18)13-5-8-21-17(11-13)20-7-2-10-25/h1,3-6,8-9,11-12,25H,2,7,10H2,(H,20,21)(H,22,23,24)
- Synonyms:
- 3-(4-(2-(3-Chlorophenylamino)Pyrimidin-4-Yl)Pyridin-2-Ylamino)Propanol