CAS 16466-44-7
:N-Ethyl-N-phenylbenzamide
Description:
N-Ethyl-N-phenylbenzamide is an organic compound characterized by its amide functional group, which consists of a benzene ring attached to a carbonyl group (C=O) and an ethyl and phenyl group. This compound typically appears as a white to off-white solid or crystalline substance. It is known for its moderate solubility in organic solvents, such as ethanol and acetone, while being less soluble in water due to its hydrophobic aromatic structure. N-Ethyl-N-phenylbenzamide may exhibit properties such as melting and boiling points that are influenced by its molecular interactions and the presence of the ethyl and phenyl substituents. The compound is of interest in various fields, including pharmaceuticals and materials science, due to its potential applications in drug formulation and as a building block in organic synthesis. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C15H15NO
InChI:InChI=1S/C15H15NO/c1-2-16(14-11-7-4-8-12-14)15(17)13-9-5-3-6-10-13/h3-12H,2H2,1H3
InChI key:InChIKey=VSURRQZMKWVYIC-UHFFFAOYSA-N
SMILES:N(C(=O)C1=CC=CC=C1)(CC)C2=CC=CC=C2
Synonyms:- Ethylbenzanilide
- Benzamide, N-ethyl-N-phenyl-
- N-Ethyl-N-phenylbenzamide
- Benzanilide, N-ethyl-
- NSC 406163
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
