CAS 164666-68-6
:3-Amino-6-chloro-2-picoline
Description:
3-Amino-6-chloro-2-picoline is an organic compound characterized by its pyridine ring structure, which includes an amino group and a chlorine substituent. It is a derivative of picoline, specifically featuring an amino group at the 3-position and a chlorine atom at the 6-position of the pyridine ring. This compound is typically a solid at room temperature and is soluble in polar solvents due to the presence of the amino group, which can engage in hydrogen bonding. The chlorine atom contributes to its reactivity, making it a useful intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. The presence of both amino and chloro functional groups allows for further chemical modifications, enhancing its utility in various chemical reactions. Additionally, 3-amino-6-chloro-2-picoline may exhibit biological activity, which can be explored in medicinal chemistry. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C6H7ClN2
InChI:InChI=1/C6H7ClN2/c1-4-5(8)2-3-6(7)9-4/h2-3H,8H2,1H3
SMILES:Cc1c(ccc(Cl)n1)N
Synonyms:- 2-Chloro-5-Amino-6-Methylpyridine
- 6-Chloro-2-Methylpyridin-3-Amine
- 5-Amino-2-chloro-6-methylpyridine
- 3-Amino-6-Chloro-2-Methylpyridine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-Amino-6-chloro-2-methylpyridine, 95%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C6H7ClN2Purity:95%Molecular weight:142.593-Pyridinamine, 6-chloro-2-methyl-
CAS:Formula:C6H7ClN2Purity:98%Color and Shape:SolidMolecular weight:142.58623-Amino-6-chloro-2-methylpyridine
CAS:3-Amino-6-chloro-2-methylpyridinePurity:98%Molecular weight:142.59g/mol3-Amino-6-chloro-2-picoline
CAS:Formula:C6H7ClN2Purity:98%Color and Shape:SolidMolecular weight:142.59



