CymitQuimica logo

CAS 1647-18-3

:

4-Chloro-4-penten-1-ol

Description:
4-Chloro-4-penten-1-ol is an organic compound characterized by its structure, which features a chlorinated carbon chain with a double bond and a hydroxyl group. It belongs to the class of alcohols and is specifically an allylic alcohol due to the presence of the double bond adjacent to the hydroxyl group. The compound has a molecular formula that reflects its carbon, hydrogen, and chlorine content, contributing to its reactivity and potential applications in organic synthesis. 4-Chloro-4-penten-1-ol is typically a colorless to pale yellow liquid, exhibiting moderate solubility in water due to the hydroxyl group, which can engage in hydrogen bonding. Its reactivity is influenced by the presence of both the double bond and the chlorine atom, making it a useful intermediate in various chemical reactions, including nucleophilic substitutions and polymerizations. Safety considerations should be taken into account, as it may pose hazards typical of chlorinated organic compounds, including potential toxicity and environmental impact.
Formula:C5H9ClO
InChI:InChI=1S/C5H9ClO/c1-5(6)3-2-4-7/h7H,1-4H2
InChI key:InChIKey=KCJKYYKWAUYUQG-UHFFFAOYSA-N
SMILES:C(C(=C)Cl)CCO
Synonyms:
  • 4-Chloro-4-penten-1-ol
  • 4-Penten-1-ol, 4-chloro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.