CAS 164736-47-4

7-Bromo-1,2,3,4-tetrahydrocyclopenta[B]indole

Description:

7-Bromo-1,2,3,4-tetrahydrocyclopenta[B]indole is a chemical compound characterized by its complex bicyclic structure, which includes a bromine substituent at the 7-position of the indole framework. This compound belongs to the class of indole derivatives, known for their diverse biological activities and potential applications in pharmaceuticals. The presence of the tetrahydrocyclopenta moiety contributes to its unique three-dimensional conformation, influencing its reactivity and interaction with biological targets. Typically, compounds of this nature exhibit properties such as moderate solubility in organic solvents and stability under standard laboratory conditions. The bromine atom can enhance the compound's electrophilicity, making it a potential candidate for further chemical modifications or reactions. Additionally, the structural features may impart specific pharmacological properties, making it of interest in medicinal chemistry. As with many indole derivatives, it may also exhibit fluorescence, which can be useful in various analytical applications. Overall, 7-Bromo-1,2,3,4-tetrahydrocyclopenta[B]indole represents a fascinating subject for research in both synthetic and medicinal chemistry.

Formula: C₇H₄ClNO

InChI: InChI=1/C7H4ClNO/c8-6-3-5(4-9)1-2-7(6)10/h1-3,10H

SMILES: c1cc(c(cc1C#N)Cl)O

Synonyms:

• cyclopent[B]indole, 7-Bromo-1,2,3,4-tetrahydro-
• 7-Bromo-1,2,3,4-tetrahydrocyclopent[b]indole

Cyclopent[b]indole, 7-bromo-1,2,3,4-tetrahydro-

CAS: 164736-47-4

Formula: C₁₁H₁₀BrN

Purity: 95%

Color and Shape: Solid

Molecular weight: 236.1078

Ref: IN-DA001V35

7-Bromo-1,2,3,4-tetrahydrocyclopenta[b]indole

CAS: 164736-47-4

7-Bromo-1,2,3,4-tetrahydrocyclopenta[b]indole

Purity: 95%

Molecular weight: 236.11g/mol

Ref: 54-OR1052328

7-Bromo-1,2,3,4-tetrahydrocyclopenta[b]indole

CAS: 164736-47-4

Purity: 98%

Molecular weight: 236.11199951171875

Ref: 10-F636031