CAS 1648-34-6

4-[(2-Fluorophenyl)sulfonyl]benzenamine

Description:

4-[(2-Fluorophenyl)sulfonyl]benzenamine, with the CAS number 1648-34-6, is an organic compound characterized by the presence of a sulfonamide functional group attached to a benzene ring. This compound features a fluorophenyl group, which enhances its chemical reactivity and potential biological activity. The sulfonyl group contributes to its solubility in polar solvents and can influence its interaction with biological targets, making it of interest in medicinal chemistry. The presence of the amino group (-NH2) allows for hydrogen bonding, which can affect its physical properties and reactivity. Typically, compounds like this may exhibit properties such as moderate to high melting points and solubility in organic solvents. Its structural features suggest potential applications in pharmaceuticals, particularly in the development of drugs targeting specific biological pathways. Additionally, the fluorine atom may impart unique electronic properties, enhancing the compound's efficacy in various chemical reactions or biological interactions. Overall, this compound's characteristics make it a subject of interest in both synthetic and medicinal chemistry.

Formula: C₁₂H₁₀FNO₂S

InChI: InChI=1S/C12H10FNO2S/c13-11-3-1-2-4-12(11)17(15,16)10-7-5-9(14)6-8-10/h1-8H,14H2

InChI key: InChIKey=GGABKJDTKJFOOS-UHFFFAOYSA-N

SMILES: S(=O)(=O)(C1=C(F)C=CC=C1)C2=CC=C(N)C=C2

Synonyms:

• Aniline, p-[(o-fluorophenyl)sulfonyl]-
• Benzenamine, 4-[(2-fluorophenyl)sulfonyl]-
• 4-[(2-Fluorophenyl)sulfonyl]benzenamine
• 4-((2-Fluorophenyl)sulfonyl)aniline

CID21480113

CAS: 1648-34-6

CID21480113, an antibacterial agent, is effective in treating dapsone resistant leprosy.

Formula: C₁₂H₁₀FNO₂S

Purity: 98%

Color and Shape: Solid

Molecular weight: 251.28

Ref: TM-T27018