CAS 1648864-59-8

1-Pyrrolidinecarboxylic acid, 3-cyano-3-(2-propen-1-yl)-, 1,1-dimethylethyl ester

Description:

1-Pyrrolidinecarboxylic acid, 3-cyano-3-(2-propen-1-yl)-, 1,1-dimethylethyl ester, identified by CAS number 1648864-59-8, is a chemical compound characterized by its complex structure, which includes a pyrrolidine ring and various functional groups such as a cyano group and an ester moiety. This compound is likely to exhibit properties typical of esters, including volatility and potential solubility in organic solvents. The presence of the cyano group suggests potential reactivity, particularly in nucleophilic addition reactions. Additionally, the 1,1-dimethylethyl group may influence the steric hindrance and overall reactivity of the molecule. Given its structural features, this compound may be of interest in synthetic organic chemistry, potentially serving as an intermediate in the synthesis of more complex molecules or as a building block in pharmaceutical applications. Its specific physical and chemical properties, such as boiling point, melting point, and reactivity, would need to be determined through experimental methods or detailed literature review.

Formula: C₁₃H₂₀N₂O₂

InChI: InChI=1S/C13H20N2O2/c1-5-6-13(9-14)7-8-15(10-13)11(16)17-12(2,3)4/h5H,1,6-8,10H2,2-4H3

InChI key: InChIKey=NCTBMZNEWVJUOP-UHFFFAOYSA-N

SMILES: C(C=C)C1(C#N)CN(C(OC(C)(C)C)=O)CC1

Synonyms:

• 1,1-Dimethylethyl 3-cyano-3-(2-propen-1-yl)-1-pyrrolidinecarboxylate
• 1-Pyrrolidinecarboxylic acid, 3-cyano-3-(2-propen-1-yl)-, 1,1-dimethylethyl ester