CAS 16489-90-0
:Dihydroethoxyquin
Description:
Dihydroethoxyquin, identified by its CAS number 16489-90-0, is a chemical compound that belongs to the class of quinones, which are characterized by their cyclic structure containing two carbonyl groups. This compound typically exhibits properties associated with its functional groups, such as potential reactivity and the ability to participate in redox reactions. Dihydroethoxyquin may be utilized in various applications, including as an intermediate in organic synthesis or in the development of pharmaceuticals. Its solubility, stability, and reactivity can vary depending on the specific conditions, such as pH and temperature. Additionally, compounds in this class may exhibit antioxidant properties, which can be beneficial in biological systems. However, detailed information regarding its specific physical and chemical properties, such as melting point, boiling point, and spectral data, would require further investigation or reference to specialized chemical databases. As with any chemical substance, safety data sheets should be consulted to understand its handling, storage, and potential hazards.
Formula:C14H21NO
InChI:InChI=1S/C14H21NO/c1-5-16-11-6-7-13-12(8-11)10(2)9-14(3,4)15-13/h6-8,10,15H,5,9H2,1-4H3
InChI key:InChIKey=YLDDCEXDGNXCIO-UHFFFAOYSA-N
SMILES:CC1C=2C(=CC=C(OCC)C2)NC(C)(C)C1
Synonyms:- 1,2,3,4-Tetrahydro-2,2,4-trimethyl-6-ethoxyquinoline
- 2,2,4-Trimethyl-6-ethoxy-1,2,3,4-tetrahydroquinoline
- 6-Ethoxy-2,2,4-Trimethyl-1,2,3,4-Tetrahydroquinoline
- Digisan
- Dihydroethoxyquin
- Ifo 6Et
- Quinoline, 6-ethoxy-1,2,3,4-tetrahydro-2,2,4-trimethyl-
- 6-Ethoxy-1,2,3,4-tetrahydro-2,2,4-trimethylquinoline
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

