CAS 16490-14-5

4-Pyrimidinecarboxylic acid, 2,6-diamino- (6CI,8CI,9CI)

Description:

4-Pyrimidinecarboxylic acid, 2,6-diamino- (CAS 16490-14-5) is an organic compound characterized by its pyrimidine ring structure, which is a six-membered aromatic heterocycle containing two nitrogen atoms at positions 1 and 3. This compound features carboxylic acid and amino functional groups, specifically two amino groups located at the 2 and 6 positions of the pyrimidine ring. These functional groups contribute to its acidic and basic properties, making it a potential candidate for various chemical reactions and applications. The presence of the carboxylic acid group allows for hydrogen bonding and solubility in polar solvents, while the amino groups can participate in nucleophilic reactions. This compound is of interest in pharmaceutical and agricultural chemistry, particularly in the synthesis of biologically active molecules. Its structural characteristics suggest potential roles in drug development, especially in targeting specific biological pathways. As with many pyrimidine derivatives, it may exhibit antimicrobial or herbicidal properties, although specific biological activities would require further investigation.

Formula: C₅H₆N₄O₂

InChI: InChI=1/C5H6N4O2/c6-3-1-2(4(10)11)8-5(7)9-3/h1H,(H,10,11)(H4,6,7,8,9)

SMILES: c1c(C(=O)O)[nH]c(=N)[nH]c1=N

Synonyms:

• Nsc46805
• 2,6-Diaminopyrimidine-4-Carboxylic Acid

2,6-Diaminopyrimidine-4-carboxylic acid

CAS: 16490-14-5

Formula: C₅H₆N₄O₂

Molecular weight: 154.1267

Ref: IN-DA001V4L

2,6-Diaminopyrimidine-4-carboxylic acid

CAS: 16490-14-5

Versatile small molecule scaffold

Formula: C₅H₆N₄O₂

Purity: Min. 95%

Molecular weight: 154.13 g/mol

Ref: 3D-RAA49014