CAS 16492-28-7

2,6-Dichloropyrimidine-4-carboxylic acid

Description:

2,6-Dichloropyrimidine-4-carboxylic acid is a heterocyclic organic compound characterized by its pyrimidine ring structure, which contains two chlorine substituents at the 2 and 6 positions and a carboxylic acid group at the 4 position. This compound is typically a white to off-white crystalline solid, and it is soluble in polar solvents such as water and alcohols, owing to the presence of the carboxylic acid functional group. The chlorine atoms contribute to its reactivity and influence its chemical properties, making it a useful intermediate in the synthesis of various pharmaceuticals and agrochemicals. The compound's molecular structure allows for potential hydrogen bonding, which can affect its boiling and melting points. Additionally, 2,6-Dichloropyrimidine-4-carboxylic acid may exhibit biological activity, making it of interest in medicinal chemistry. Safety data should be consulted for handling and storage, as halogenated compounds can pose environmental and health risks.

Formula: C₅H₂Cl₂N₂O₂

InChI: InChI=1/C5H2Cl2N2O2/c6-3-1-2(4(10)11)8-5(7)9-3/h1H,(H,10,11)/p-1

SMILES: c1c(C(=O)[O-])nc(Cl)nc1Cl

4-Pyrimidinecarboxylic acid, 2,6-dichloro-

CAS: 16492-28-7

Formula: C₅H₂Cl₂N₂O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 192.9876

Ref: IN-DA001V69

2,6-Dichloropyrimidine-4-carboxylic acid

CAS: 16492-28-7

2,6-Dichloropyrimidine-4-carboxylic acid

Purity: 98%

Molecular weight: 192.99g/mol

Ref: 54-OR480754

2,6-Dichloropyrimidine-4-carboxylic acid

CAS: 16492-28-7

2,6-Dichloropyrimidine-4-carboxylic acid is a pyrimidine that can be used as a starting material for the synthesis of other compounds. It is an intermediate in the manufacture of anilines and pyrimidines. 2,6-Dichloropyrimidine-4-carboxylic acid is also used in the production of dyes and agrochemicals.

Formula: C₅H₂Cl₂N₂O₂

Purity: Min. 95%

Color and Shape: White Powder

Molecular weight: 192.99 g/mol

Ref: 3D-FD147587

2,6-Dichloropyrimidine-4-carboxylic acid

CAS: 16492-28-7

Formula: C₅H₂Cl₂N₂O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 192.98

Ref: 10-F044308