CAS 16492-28-7
:2,6-Dichloropyrimidine-4-carboxylic acid
Description:
2,6-Dichloropyrimidine-4-carboxylic acid is a heterocyclic organic compound characterized by its pyrimidine ring structure, which contains two chlorine substituents at the 2 and 6 positions and a carboxylic acid group at the 4 position. This compound is typically a white to off-white crystalline solid, and it is soluble in polar solvents such as water and alcohols, owing to the presence of the carboxylic acid functional group. The chlorine atoms contribute to its reactivity and influence its chemical properties, making it a useful intermediate in the synthesis of various pharmaceuticals and agrochemicals. The compound's molecular structure allows for potential hydrogen bonding, which can affect its boiling and melting points. Additionally, 2,6-Dichloropyrimidine-4-carboxylic acid may exhibit biological activity, making it of interest in medicinal chemistry. Safety data should be consulted for handling and storage, as halogenated compounds can pose environmental and health risks.
Formula:C5H2Cl2N2O2
InChI:InChI=1/C5H2Cl2N2O2/c6-3-1-2(4(10)11)8-5(7)9-3/h1H,(H,10,11)/p-1
SMILES:c1c(C(=O)[O-])nc(Cl)nc1Cl
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-Pyrimidinecarboxylic acid, 2,6-dichloro-
CAS:Formula:C5H2Cl2N2O2Purity:98%Color and Shape:SolidMolecular weight:192.9876Ref: IN-DA001V69
1g56.00€5g128.00€10g168.00€25g240.00€50g532.00€100gTo inquire250gTo inquire100mg24.00€250mg28.00€2,6-Dichloropyrimidine-4-carboxylic acid
CAS:2,6-Dichloropyrimidine-4-carboxylic acidPurity:98%Molecular weight:192.99g/mol2,6-Dichloropyrimidine-4-carboxylic acid
CAS:Formula:C5H2Cl2N2O2Purity:97%Color and Shape:SolidMolecular weight:192.982,6-Dichloropyrimidine-4-carboxylic acid
CAS:2,6-Dichloropyrimidine-4-carboxylic acid is a pyrimidine that can be used as a starting material for the synthesis of other compounds. It is an intermediate in the manufacture of anilines and pyrimidines. 2,6-Dichloropyrimidine-4-carboxylic acid is also used in the production of dyes and agrochemicals.Formula:C5H2Cl2N2O2Purity:Min. 95%Color and Shape:White PowderMolecular weight:192.99 g/molRef: 3D-FD147587
Discontinued product



