CAS 164926-91-4

2-(4-METHYL-PIPERAZIN-1-YL)-THIOACETAMIDE

Description:

2-(4-Methyl-piperazin-1-yl)-thioacetamide is a chemical compound characterized by its unique structure, which includes a piperazine ring substituted with a methyl group and a thioacetamide functional group. This compound typically exhibits properties associated with both amines and thioamides, such as potential basicity due to the piperazine moiety and nucleophilicity from the thioacetamide group. It may be soluble in polar organic solvents, reflecting the presence of the piperazine nitrogen atoms, which can engage in hydrogen bonding. The thioacetamide group can participate in various chemical reactions, including nucleophilic substitutions and condensation reactions. This compound may also exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its specific applications and reactivity can vary based on the presence of functional groups and the overall molecular environment. As with many chemical substances, safety data sheets should be consulted for handling and toxicity information.

Formula: C₇H₁₅N₃S

InChI: InChI=1/C7H15N3S/c1-9-2-4-10(5-3-9)6-7(8)11/h2-6H2,1H3,(H2,8,11)

SMILES: CN1CCN(CC1)CC(=N)S

Synonyms:

• 1-Piperazineethanethioamide,4-methyl-(9CI)
• 2-(4-Methylpiperazin-1-Yl)Ethanethioamide

2-(4-Methylpiperazin-1-yl)ethanethioamide

CAS: 164926-91-4

Formula: C₇H₁₅N₃S

Molecular weight: 173.2791

Ref: IN-DA001V5T

2-(4-Methyl-piperazin-1-yl)-thioacetamide

CAS: 164926-91-4

Versatile small molecule scaffold

Formula: C₇H₁₅N₃S

Purity: Min. 95%

Molecular weight: 173.28 g/mol

Ref: 3D-PGA92691