CAS 16493-80-4
:4-Ethyloctanoic acid
Description:
4-Ethyloctanoic acid, with the CAS number 16493-80-4, is a branched-chain fatty acid characterized by its eight-carbon backbone and an ethyl group attached to the fourth carbon. This compound is typically a colorless to pale yellow liquid at room temperature and has a distinct fatty odor. It is soluble in organic solvents but has limited solubility in water due to its hydrophobic nature. The presence of a carboxylic acid functional group imparts acidic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. 4-Ethyloctanoic acid is often used in the synthesis of surfactants, lubricants, and plasticizers, as well as in the formulation of certain pharmaceuticals and cosmetics. Its branched structure can influence its physical properties, such as melting and boiling points, making it distinct from its straight-chain counterparts. Safety data indicates that, like many fatty acids, it should be handled with care to avoid skin and eye irritation.
Formula:C10H20O2
InChI:InChI=1S/C10H20O2/c1-3-5-6-9(4-2)7-8-10(11)12/h9H,3-8H2,1-2H3,(H,11,12)
InChI key:InChIKey=PWKJMPFEQOHBAC-UHFFFAOYSA-N
SMILES:C(CCC(O)=O)(CCCC)CC
Synonyms:- (4R)-4-ethyloctanoate
- (4S)-4-ethyloctanoate
- 4-Ethyl Octanoic Acid
- 4-Ethylcaprylic acid
- Octanoic acid, 4-ethyl-
- 4-Ethyloctanoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
4-Ethyloctanoic acid, 97%
CAS:<p>Five sulfur-containing flavor compounds were synthesized by the reaction of 4-ethyloctanoyl chloride with sulfur-containing alcohols or mercaptans. 4-ethyloctanoic acid is identified from flue-cured Virginia tobacco. Mainly used as daily flavor,food flavor,industrial flavor, nutrient, stabilizers, </p>Formula:C10H19O2Purity:97%Color and Shape:Clear colorless, LiquidMolecular weight:171.26Octanoic acid, 4-ethyl-
CAS:Formula:C10H20O2Purity:98%Color and Shape:LiquidMolecular weight:172.26464-Ethyloctanoic Acid, 10mM (in DMSO)
CAS:4-Ethyloctanoic Acid, 10mM (in DMSO)Purity:≥95%Molecular weight:172.26g/mol4-Ethyloctanoic acid
CAS:4-Ethyloctanoic acid is a natural product isolated from Saussurea lappa Clarke,acts as food additive,Industrial perfume,and so on.Formula:C10H20O2Purity:97.6%Color and Shape:Less Liquid Colorless LiquidMolecular weight:172.26




