CAS 16499-05-1: 7,8-Dihydro-8,8-dimethyl-2H,6H-benzo[1,2-b:5,4-b′]dipyran-2,6-dione

Description:7,8-Dihydro-8,8-dimethyl-2H,6H-benzo[1,2-b:5,4-b′]dipyran-2,6-dione, with CAS number 16499-05-1, is a synthetic organic compound characterized by its complex polycyclic structure, which includes fused benzopyran and dipyran moieties. This compound typically exhibits a range of chemical properties, including potential antioxidant activity due to the presence of the diketone functional groups. Its molecular structure suggests it may participate in various chemical reactions, such as nucleophilic additions or cycloadditions, owing to the reactivity of the carbonyl groups. The presence of dimethyl substituents can influence its solubility and stability, making it potentially useful in various applications, including pharmaceuticals and materials science. Additionally, its unique structure may impart specific optical properties, making it of interest in studies related to photochemistry. Overall, 7,8-Dihydro-8,8-dimethyl-2H,6H-benzo[1,2-b:5,4-b′]dipyran-2,6-dione represents a fascinating subject for further research in organic chemistry and related fields.

Formula:C₁₄H₁₂O₄

InChI:InChI=1S/C14H12O4/c1-14(2)7-10(15)9-5-8-3-4-13(16)17-11(8)6-12(9)18-14/h3-6H,7H2,1-2H3

InChI key:InChIKey=WEDGVCZUPFZNDE-UHFFFAOYSA-N

SMILES:O=C1OC=2C=C3OC(C)(C)CC(=O)C3=CC2C=C1