CAS 16499-66-4

4-Chloro-8-(trifluoromethyl)quinazoline

Description:

4-Chloro-8-(trifluoromethyl)quinazoline is a heterocyclic organic compound characterized by its quinazoline core, which consists of a fused benzene and pyrimidine ring structure. The presence of a chloro group at the 4-position and a trifluoromethyl group at the 8-position significantly influences its chemical properties and reactivity. This compound is typically a solid at room temperature and exhibits moderate solubility in organic solvents. It is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological targets. The trifluoromethyl group enhances lipophilicity and metabolic stability, making it a valuable moiety in drug design. Additionally, the compound may exhibit biological activities such as antimicrobial or anticancer properties, although specific activities can vary based on structural modifications and the biological context. Safety and handling precautions should be observed, as with many halogenated compounds, due to potential toxicity and environmental concerns.

Formula: C₉H₄ClF₃N₂

InChI: InChI=1S/C9H4ClF3N2/c10-8-5-2-1-3-6(9(11,12)13)7(5)14-4-15-8/h1-4H

InChI key: InChIKey=SIYUSYOXHWFHGY-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C=1C2=C(C(Cl)=NC=N2)C=CC1

Synonyms:

• Quinazoline, 4-chloro-8-(trifluoromethyl)-
• 4-Chloro-8-(trifluoromethyl)quinazoline

4-Chloro-8-(trifluoromethyl)quinazoline

CAS: 16499-66-4

Versatile small molecule scaffold

Formula: C₉H₄ClF₃N₂

Purity: Min. 95%

Molecular weight: 232.59 g/mol

Ref: 3D-RAA49966