CAS 16503-32-5
:Brevilin A
Description:
Brevilin A is a natural compound classified as a sesquiterpene lactone, primarily derived from the plant species *Centipeda minima*. It is known for its potential pharmacological properties, including anti-inflammatory, antimicrobial, and anticancer activities. The molecular structure of Brevilin A features a unique bicyclic framework, which contributes to its biological activity. This compound has garnered interest in medicinal chemistry due to its ability to modulate various biological pathways, making it a candidate for further research in drug development. Additionally, Brevilin A exhibits a relatively low toxicity profile, which is advantageous for therapeutic applications. Its solubility characteristics can vary, influencing its bioavailability and efficacy in biological systems. Overall, Brevilin A represents a significant area of study within natural product chemistry, with ongoing investigations aimed at elucidating its mechanisms of action and potential therapeutic uses.
Formula:C20H26O5
InChI:InChI=1S/C20H26O5/c1-6-10(2)18(22)25-17-16-12(4)19(23)24-14(16)9-11(3)13-7-8-15(21)20(13,17)5/h6-8,11-14,16-17H,9H2,1-5H3/b10-6-/t11-,12+,13+,14-,16-,17+,20+/m1/s1
InChI key:InChIKey=KUPPZVXLWANEJJ-UXPPPGSFSA-N
SMILES:O(C(/C(=C\C)/C)=O)[C@H]1[C@]2([C@@](C[C@@H](C)[C@]3([C@@]1(C)C(=O)C=C3)[H])(OC(=O)[C@H]2C)[H])[H]
Synonyms:- 2-Butenoic acid, 2-methyl-, (3S,3aR,4S,4aR,7aR,8R,9aR)-2,3,3a,4,4a,5,7a,8,9,9a-decahydro-3,4a,8-trimethyl-2,5-dioxoazuleno[6,5-b]furan-4-yl ester, (2Z)-
- 2-Butenoic acid, 2-methyl-, 2,3,3a,4,4a,5,7a,8,9,9a-decahydro-3,4a,8-trimethyl-2,5-dioxoazuleno[6,5-b]furan-4-yl ester, [3S-[3α,3aβ,4β(Z),4aα,7aβ,8β,9aβ]]-
- 2-Butenoicacid, 2-methyl-,2,3,3a,4,4a,5,7a,8,9,9a-decahydro-3,4a,8-trimethyl-2,5-dioxoazuleno[6,5-b]furan-4-ylester, [3S-[3a,3ab,4b(Z),4aa,7ab,8b,9ab]]-
- 6-O-Angeloylplenolin
- 6-O-Angeloylprenolin
- Ambros-2-en-12-oic acid, 6a,8b-dihydroxy-4-oxo-, 12,8-lactone, 2-methylcrotonate, (Z)- (8CI)
- Ambros-2-en-12-oic acid, 6α,8β-dihydroxy-4-oxo-, 12,8-lactone, 2-methylcrotonate, (Z)-
- Azuleno[6,5-b]furan, 2-butenoic acid deriv.
- Brevelin A
- Brevilin A
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
2-Butenoic acid, 2-methyl-, (3S,3aR,4S,4aR,7aR,8R,9aR)-2,3,3a,4,4a,5,7a,8,9,9a-decahydro-3,4a,8-trimethyl-2,5-dioxoazuleno[6,5-b]furan-4-yl ester, (2Z)-
CAS:Formula:C20H26O5Purity:99%Color and Shape:SolidMolecular weight:346.4174Brevilin A
CAS:Brevilin A is a strong impetus for the development of selective JAK-STAT inhibitors and therapeutic drugs in order to improve survival of patients with hyperactivated JAKs and STATs. Brevilin A shows antigiardial activity (IC50 = 16.1 μM) and is similarly active in vitro against Entamoeba histolytica (IC50 between 4.5 and 9 μM) and against Plasmodium falciparum (IC50 = 9.42 μM).Formula:C20H26O5Purity:95%~99%Molecular weight:346.423Brevilin A
CAS:Brevilin A, a sesquiterpene from Centipeda minima, hinders JAK and blocks STAT3 (IC50=10.6μM), inducing apoptosis and autophagy in cancer cells.Formula:C20H26O5Purity:99.97% - >99.99%Color and Shape:SolidMolecular weight:346.42Ref: TM-T4672
1mg90.00€5mg203.00€1mL*10mM (DMSO)224.00€10mg350.00€25mg578.00€50mg797.00€100mg1,071.00€500mg2,187.00€Brevilin a
CAS:LactoneFormula:C20H26O5Purity:≥ 90.0 % (HPLC)Color and Shape:PowderMolecular weight:346.42





