CAS 165047-24-5

2,4,5-Trifluorobenzaldehyde

Description:

2,4,5-Trifluorobenzaldehyde is an aromatic aldehyde characterized by the presence of three fluorine atoms attached to a benzene ring, specifically at the 2, 4, and 5 positions relative to the aldehyde functional group. This compound is notable for its high reactivity due to the electron-withdrawing nature of the fluorine atoms, which can influence its chemical behavior and interactions. It typically appears as a colorless to pale yellow liquid with a distinct odor. The presence of the aldehyde group contributes to its reactivity, making it a useful intermediate in organic synthesis, particularly in the production of pharmaceuticals and agrochemicals. Additionally, 2,4,5-trifluorobenzaldehyde may exhibit unique physical properties, such as a relatively low boiling point and moderate solubility in organic solvents. Its fluorinated structure can also impart specific characteristics, such as increased lipophilicity and altered metabolic stability, which are valuable in medicinal chemistry. Safety precautions should be observed when handling this compound due to its potential toxicity and reactivity.

Formula: C₇H₃F₃O

InChI: InChI=1S/C7H3F3O/c8-5-2-7(10)6(9)1-4(5)3-11/h1-3H

InChI key: InChIKey=CYIFJRXFYSUBFW-UHFFFAOYSA-N

SMILES: C(=O)C1=C(F)C=C(F)C(F)=C1

Synonyms:

• 2,4,5-Trifluorobenzaldehyde
• Benzaldehyde, 2,4,5-trifluoro-

2,4,5-Trifluorobenzaldehyde

CAS: 165047-24-5

Formula: C₇H₃F₃O

Purity: 95%

Color and Shape: Liquid

Molecular weight: 160.0933

Ref: IN-DA003290

2,4,5-Trifluorobenzaldehyde

CAS: 165047-24-5

2,4,5-Trifluorobenzaldehyde

Formula: C₇H₃F₃O

Purity: 98%

Color and Shape: clear. almost colourless liquid

Molecular weight: 160.09g/mol

Ref: 54-PC7265J

2,4,5-Trifluorobenzaldehyde

CAS: 165047-24-5

Formula: C₇H₃F₃O

Molecular weight: 160.10

Ref: 7W-GP7694

2,4,5-Trifluorobenzaldehyde

CAS: 165047-24-5

Formula: C₇H₃F₃O

Purity: >98.0%(GC)

Color and Shape: Colorless to Yellow to Green clear liquid

Molecular weight: 160.10

Ref: 3B-T2319

2,4,5-Trifluorobenzaldehyde

CAS: 165047-24-5

Formula: C₇H₃F₃O

Purity: 95%

Color and Shape: Liquid, Clear

Molecular weight: 160.095

Ref: 10-F001871

2,4,5-Trifluorobenzaldehyde

Controlled Product

CAS: 165047-24-5

Applications 2,4,5-Trifluorobenzaldehyde is a reactant in the enantioselective synthesis of (R)-selegiline, an anti-Parkinson's drug, (S)-benzphetamine, an anti-obesity agent, and (S)-sitagliptin, an anti-diabetic drug.
Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the package
References Dey, S., Sudalai, A.: Tetrahedron-Asymmetr., 26, 67 (2015)

Formula: C₇H₃F₃O

Color and Shape: Neat

Molecular weight: 160.09

Ref: TR-T790010