CAS 16508-95-5
:Bismuth sesquicarbonate
Description:
Bismuth sesquicarbonate, with the CAS number 16508-95-5, is an inorganic compound composed of bismuth, carbon, and oxygen. It typically appears as a white or off-white powder and is known for its low solubility in water, which makes it useful in various applications, particularly in pharmaceuticals and cosmetics. This compound is often utilized for its antacid properties, providing relief from gastrointestinal discomfort by neutralizing stomach acid. Bismuth sesquicarbonate can also serve as a precursor for other bismuth compounds and is involved in the formulation of certain medicinal products aimed at treating conditions like peptic ulcers and diarrhea. Additionally, it exhibits mild antibacterial properties, contributing to its therapeutic efficacy. The compound is generally considered safe for use in appropriate doses, although, like all substances, it should be handled with care to avoid potential toxicity. Its stability under normal conditions makes it a reliable choice in various industrial and medical applications.
Formula:CH2O3Bi
InChI:InChI=1S/CH2O3.Bi/c2-1(3)4;/h(H2,2,3,4);
InChI key:InChIKey=OXVUOXIYUOVHRJ-UHFFFAOYSA-N
SMILES:C(=O)(O)O.[Bi]
Synonyms:- Bismuth carbonate
- Carbonic acid, bismuth(3+) salt (3:2)
- Dibismuth tricarbonate
- Bismuth sesquicarbonate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.