CymitQuimica logo

CAS 16511-39-0

:

4-Acetyl-2(1H)-quinolinone

Description:
4-Acetyl-2(1H)-quinolinone, with the CAS number 16511-39-0, is an organic compound that belongs to the class of quinolinones, which are heterocyclic compounds containing a fused benzene and pyridine ring. This substance typically exhibits a yellow to brown crystalline appearance and is characterized by its acetyl group at the 4-position and a keto group at the 2-position of the quinoline structure. It is known for its potential biological activities, including antimicrobial and anti-inflammatory properties, making it of interest in pharmaceutical research. The compound is soluble in organic solvents, such as ethanol and acetone, but may have limited solubility in water. Its molecular structure allows for various chemical reactions, including nucleophilic substitutions and condensation reactions, which can be exploited in synthetic organic chemistry. Additionally, 4-acetyl-2(1H)-quinolinone can serve as a precursor for the synthesis of more complex molecules, contributing to its relevance in medicinal chemistry and material science.
Formula:C11H9NO2
InChI:InChI=1S/C11H9NO2/c1-7(13)9-6-11(14)12-10-5-3-2-4-8(9)10/h2-6H,1H3,(H,12,14)
InChI key:InChIKey=TVAHXHRNSSBFSY-UHFFFAOYSA-N
SMILES:C(C)(=O)C=1C=2C(NC(=O)C1)=CC=CC2
Synonyms:
  • 4-Acetyl-2(1H)-quinolinone
  • 2(1H)-Quinolinone, 4-acetyl-
  • Carbostyril, 4-acetyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.