CAS 16517-53-6
:N-(3-Hydroxypropyl)urea
Description:
N-(3-Hydroxypropyl)urea, with the CAS number 16517-53-6, is an organic compound characterized by the presence of a urea functional group and a hydroxypropyl substituent. This compound typically appears as a white crystalline solid and is soluble in water due to its polar nature, which is attributed to both the urea and hydroxy groups. It exhibits properties such as hydrogen bonding capabilities, which can influence its reactivity and interactions with other molecules. N-(3-Hydroxypropyl)urea is often studied for its potential applications in pharmaceuticals, agriculture, and as a biochemical reagent. Its structure allows it to participate in various chemical reactions, including those involving nucleophilic attack and hydrogen bonding. Additionally, it may exhibit biological activity, making it of interest in medicinal chemistry. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance. Overall, N-(3-Hydroxypropyl)urea represents a versatile compound with significant implications in both research and industrial applications.
Formula:C4H10N2O2
InChI:InChI=1S/C4H10N2O2/c5-4(8)6-2-1-3-7/h7H,1-3H2,(H3,5,6,8)
InChI key:InChIKey=DNPHEDNKXRMPAX-UHFFFAOYSA-N
SMILES:N(CCCO)C(N)=O
Synonyms:- Urea, (3-hydroxypropyl)-
- (3-Hydroxypropyl)urea
- Urea, N-(3-hydroxypropyl)-
- N-(3-Hydroxypropyl)urea
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.