CAS 165187-24-6

2-CHLORO-3-CYANOBENZALDEHYDE

Description:

2-Chloro-3-cyanobenzaldehyde is an organic compound characterized by its aromatic structure, which includes a benzaldehyde functional group, a chloro substituent, and a cyano group. The presence of the chloro group introduces a degree of electrophilicity to the aromatic ring, potentially influencing its reactivity in various chemical reactions, such as nucleophilic substitutions or electrophilic aromatic substitutions. The cyano group contributes to the compound's polarity and can participate in further chemical transformations, making it a versatile intermediate in organic synthesis. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its unique functional groups suggest potential applications in pharmaceuticals, agrochemicals, or as a building block in the synthesis of more complex molecules. Safety data should be consulted, as halogenated compounds can pose health risks, and appropriate handling and storage conditions are essential to ensure safety in laboratory settings.

Formula: C₈H₄ClNO

InChI: InChI=1/C8H4ClNO/c9-8-6(4-10)2-1-3-7(8)5-11/h1-3,5H

SMILES: c1cc(C#N)c(c(c1)C=O)Cl

Synonyms:

• 2-Chloro-3-Formylbenzonitrile

Benzonitrile, 2-chloro-3-formyl-

CAS: 165187-24-6

Formula: C₈H₄ClNO

Purity: 97%

Color and Shape: Solid

Molecular weight: 165.5765

Ref: IN-DA001VZE

2-Chloro-3-cyanobenzaldehyde

CAS: 165187-24-6

2-Chloro-3-cyanobenzaldehyde

Purity: 97%

Molecular weight: 165.58g/mol

Ref: 54-OR905987

2-Chloro-3-cyanobenzaldehyde

CAS: 165187-24-6

Formula: C₈H₄ClNO

Purity: 95%

Color and Shape: Solid

Molecular weight: 165.58

Ref: 10-F079729