CAS 165190-62-5
:4-Benzyloxy-2-bromonitrobenzene
Description:
4-Benzyloxy-2-bromonitrobenzene is an organic compound characterized by its aromatic structure, which includes a nitro group (-NO2), a bromine atom (Br), and a benzyloxy group (-O-PhCH2) attached to a benzene ring. This compound typically exhibits a pale yellow to light brown appearance and is soluble in organic solvents such as dichloromethane and acetone, but has limited solubility in water due to its hydrophobic aromatic components. The presence of the nitro group contributes to its electron-withdrawing properties, influencing its reactivity and making it a potential candidate for various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. The bromine atom can serve as a leaving group in synthetic applications, while the benzyloxy group can be converted into other functional groups through various chemical transformations. Overall, 4-Benzyloxy-2-bromonitrobenzene is of interest in organic synthesis and materials science, particularly in the development of pharmaceuticals and agrochemicals.
Formula:C13H10BrNO3
InChI:InChI=1/C13H10BrNO3/c14-12-8-11(6-7-13(12)15(16)17)18-9-10-4-2-1-3-5-10/h1-8H,9H2
SMILES:c1ccc(cc1)COc1ccc(c(c1)Br)N(=O)=O
Synonyms:- 2-Bromo-1-nitro-4-(phenylmethoxy)-benzen
- 2-Bromo-1-nitro-4-(phenylmethoxy)-benzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
4-Benzyloxy-2-bromonitrobenzene
CAS:Controlled ProductApplications 4-Benzyloxy-2-bromonitrobenzene (cas# 165190-62-5) is a compound useful in organic synthesis.
Formula:C13H10BrNO3Color and Shape:NeatMolecular weight:308.13

