CAS 16520-78-8
:8-Methoxycirsilineol
Description:
8-Methoxycirsilineol is a chemical compound that belongs to the class of flavonoids, which are known for their diverse biological activities and potential health benefits. This substance is characterized by the presence of a methoxy group attached to the cirsilineol structure, which contributes to its unique properties. Flavonoids, including 8-Methoxycirsilineol, are often recognized for their antioxidant, anti-inflammatory, and antimicrobial activities. The compound may also exhibit potential therapeutic effects, making it of interest in pharmacological research. Its solubility, stability, and reactivity can vary depending on environmental conditions and the presence of other substances. As with many flavonoids, 8-Methoxycirsilineol may be found in various plant sources, contributing to the plant's color and health benefits. Further studies are often necessary to fully elucidate its mechanisms of action and potential applications in medicine and nutrition.
Formula:C19H18O8
InChI:InChI=1S/C19H18O8/c1-23-13-7-9(5-6-10(13)20)12-8-11(21)14-15(22)17(24-2)19(26-4)18(25-3)16(14)27-12/h5-8,20,22H,1-4H3
InChI key:InChIKey=UBZBPKARIHPOEC-UHFFFAOYSA-N
SMILES:O(C)C1=C2C(=C(O)C(OC)=C1OC)C(=O)C=C(O2)C3=CC(OC)=C(O)C=C3
Synonyms:- 4H-1-benzopyran-4-one, 5-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-6,7,8-trimethoxy-
- 4′,5-Dihydroxy-3′,6,7,8-tetramethoxyflavone
- 5,4′-Didemethylnobiletin
- 5,4′-Dihydroxy-6,7,8,3′-tetramethoxyflavone
- 5-Hydroxy-2-(4-hydroxy-3-methoxyphenyl)-6,7,8-trimethoxy-4H-1-benzopyran-4-one
- 7-Methylsudachitin
- 7-O-Methylsudachietin
- 8-Methoxycirsilineol
- Flavone, 4′,5-dihydroxy-3′,6,7,8-tetramethoxy-
- Methylsudachitin
- NSC 654971
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
4H-1-Benzopyran-4-one, 5-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-6,7,8-trimethoxy-
CAS:Formula:C19H18O8Molecular weight:374.34147-Methylsudachitin
CAS:<p>7-Methylsudachitin is a useful organic compound for research related to life sciences. The catalog number is T125643 and the CAS number is 16520-78-8.</p>Formula:C19H18O8Color and Shape:SolidMolecular weight:374.3458-Methoxycirsilineol
CAS:<p>8-Methoxycirsilineol is a flavonoid compound, which is a phytochemical naturally occurring in various plants. It is primarily sourced from the leaves and stems of certain medicinal plants where it is concentrated as part of the plants' secondary metabolites. Its mode of action includes significant antioxidant and anti-inflammatory activities, achieved through the scavenging of free radicals and inhibition of pro-inflammatory pathways. In scientific studies, 8-Methoxycirsilineol has been investigated for its potential impact on reducing oxidative stress and modulating immune responses, making it of interest for applications in pharmacology and nutraceuticals. Researchers are exploring its potential role in protecting against chronic inflammatory conditions and its ability to support cellular health. Its natural origin and biological activities make it a valuable subject of study in the development of therapeutic agents aimed at managing oxidative and inflammatory stress-related disorders.</p>Formula:C19H18O8Purity:Min. 95%Molecular weight:374.34 g/mol


