
CAS 165261-13-2
:6-Methyl-7-oxa-1-thia-4-azaspiro[4.4]nonane
Description:
6-Methyl-7-oxa-1-thia-4-azaspiro[4.4]nonane is a heterocyclic organic compound characterized by its unique spirocyclic structure, which includes both nitrogen and sulfur atoms, as well as an oxygen atom in its framework. The compound features a spiro arrangement, indicating that it consists of two rings that share a common atom, contributing to its rigidity and potential biological activity. The presence of the methyl group at the 6-position and the heteroatoms (oxygen and sulfur) enhances its chemical reactivity and may influence its interaction with biological targets. This compound is of interest in medicinal chemistry and drug development due to its structural complexity and potential pharmacological properties. Its CAS number, 165261-13-2, allows for easy identification in chemical databases. Overall, 6-Methyl-7-oxa-1-thia-4-azaspiro[4.4]nonane exemplifies the diversity of organic compounds that can be synthesized for various applications in research and industry.
Formula:C7H13NOS
InChI:InChI=1S/C7H13NOS/c1-6-7(2-4-9-6)8-3-5-10-7/h6,8H,2-5H2,1H3
InChI key:InChIKey=OPFPLXAEUOBWQR-UHFFFAOYSA-N
SMILES:CC1C2(NCCS2)CCO1
Synonyms:- 6-Methyl-7-oxa-1-thia-4-azaspiro[4.4]nonane
- 7-Oxa-1-thia-4-azaspiro[4.4]nonane, 6-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.