CAS 16529-06-9

2-(1H-benzimidazol-2-yl)benzoic acid

Description:

2-(1H-benzimidazol-2-yl)benzoic acid, with the CAS number 16529-06-9, is an organic compound characterized by its dual functional groups: a benzimidazole moiety and a carboxylic acid group. This compound typically appears as a solid and is known for its potential applications in pharmaceuticals and biochemistry due to its ability to interact with biological systems. The benzimidazole structure contributes to its aromatic properties and can facilitate interactions with various biological targets, making it of interest in medicinal chemistry. The carboxylic acid group enhances its solubility in polar solvents and allows for potential derivatization, which can be useful in drug formulation. Additionally, this compound may exhibit interesting acid-base properties, influencing its reactivity and interaction with other molecules. Its unique structure and functional groups make it a subject of study for various chemical and biological applications, including its role as a ligand in coordination chemistry and its potential therapeutic effects.

Formula: C₁₄H₁₀N₂O₂

InChI: InChI=1/C14H10N2O2/c17-14(18)10-6-2-1-5-9(10)13-15-11-7-3-4-8-12(11)16-13/h1-8H,(H,15,16)(H,17,18)

SMILES: c1ccc(c(c1)c1nc2ccccc2[nH]1)C(=O)O

Synonyms:

• Benzoic acid, 2-(1H-benzimidazol-2-yl)-
• 2-(1H-Benzimidazol-2-yl)benzoic acid

2-(1H-Benzo[d]imidazol-2-yl)benzoic acid

CAS: 16529-06-9

Formula: C₁₄H₁₀N₂O₂

Molecular weight: 238.2414

Ref: IN-DA001W28

2-(1H-Benzo[d]imidazol-2-yl)benzoic acid

CAS: 16529-06-9

2-(1H-Benzo[d]imidazol-2-yl)benzoic acid is a primary amine that inhibits the growth of bacteria by binding to their amino acid receptors. It has been shown to be active against a wide range of bacterial species, including Staphylococcus aureus and Salmonella enterica. 2-(1H-Benzo[d]imidazol-2-yl)benzoic acid is an efficient method for the synthesis of antibiotics and other pharmaceuticals that contain an ethyl group. The catalytic mechanism of this compound involves protonation at the carbon atom adjacent to the nitrogen atom on the imidazole ring, followed by nucleophilic attack by water. This process leads to formation of an oxime intermediate and release of ammonia as a product.

Formula: C₁₄H₁₀N₂O₂

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 238.24 g/mol

Ref: 3D-FB142013