CAS 165315-26-4

N~2~-{[(2-ethyl-1,3-thiazol-4-yl)methyl](methyl)carbamoyl}-N-[(2S,4S,5S)-4-hydroxy-1,6-diphenyl-5-{[(1,3-thiazol-5-ylmethoxy)carbonyl]amino}hexan-2-yl]-L-valinamide

Description:

The chemical substance with the name "N~2~-{[(2-ethyl-1,3-thiazol-4-yl)methyl](methyl)carbamoyl}-N-[(2S,4S,5S)-4-hydroxy-1,6-diphenyl-5-{[(1,3-thiazol-5-ylmethoxy)carbonyl]amino}hexan-2-yl]-L-valinamide" and CAS number 165315-26-4 is a complex organic compound characterized by its thiazole and valinamide moieties. It features multiple functional groups, including carbamoyl and hydroxy groups, which contribute to its potential biological activity. The presence of chiral centers indicates that the compound may exhibit stereoisomerism, which can influence its pharmacological properties. This compound is likely to be of interest in medicinal chemistry, particularly in the development of therapeutic agents, due to its structural complexity and the presence of various bioactive elements. Its solubility, stability, and reactivity would depend on the specific conditions and solvents used, as well as its interactions with biological targets. Further studies would be necessary to elucidate its mechanism of action and potential applications in drug development.

Formula: C₃₆H₄₆N₆O₅S₂

InChI: InChI=1/C36H46N6O5S2/c1-5-32-38-28(22-48-32)20-42(4)35(45)41-33(24(2)3)34(44)39-27(16-25-12-8-6-9-13-25)18-31(43)30(17-26-14-10-7-11-15-26)40-36(46)47-21-29-19-37-23-49-29/h6-15,19,22-24,27,30-31,33,43H,5,16-18,20-21H2,1-4H3,(H,39,44)(H,40,46)(H,41,45)/t27-,30-,31-,33-/m0/s1

SMILES: CCc1nc(CN(C)C(=N[C@@H](C(C)C)C(=N[C@@H](Cc2ccccc2)C[C@@H]([C@H](Cc2ccccc2)N=C(O)OCc2cncs2)O)O)O)cs1

Ritonavir EP Impurity I

CAS: 165315-26-4

Formula: C₃₆H₄₆N₆O₅S₂

Color and Shape: White To Off-White Solid

Molecular weight: 706.92

Ref: 4Z-R-2721

2-Desisopropyl-2-ethyl Ritonavir

Controlled Product

CAS: 165315-26-4

Formula: C₃₆H₄₆N₆O₅S₂

Color and Shape: Neat

Molecular weight: 706.92

Ref: TR-D290245

2-Desisopropyl-2-ethyl ritonavir

CAS: 165315-26-4

2-Desisopropyl-2-ethyl ritonavir (2DPR) is a peptidomimetic inhibitor of the human immunodeficiency virus type 1 (HIV-1) protease, which prevents the cleavage of polyproteins into their constituent proteins. 2DPR interacts with the HIV-1 protease at the active site and inhibits its activity. 2DPR binds to a receptor on the surface of cells, which triggers an intracellular signal that activates ion channels. The ion channels are protein pores that allow ions to pass through the cell membrane, causing an electric current or voltage change in the cell. 2DPR is not active against other viruses and does not inhibit protein synthesis in cells.

Formula: C₃₆H₄₆N₆O₅S₂

Purity: Min. 95%

Molecular weight: 706.9 g/mol

Ref: 3D-QGA31526

Ritonavir EP Impurity I

CAS: 165315-26-4

Formula: C₃₆H₄₆N₆O₅S₂

Molecular weight: 706.9

Ref: ST-EA-CP-R16009