
CAS 165315-75-3
:Ethyl 2-(1-methylethyl)-5-thiazolecarboxylate
Description:
Ethyl 2-(1-methylethyl)-5-thiazolecarboxylate, identified by its CAS number 165315-75-3, is an organic compound characterized by the presence of a thiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen. This compound features an ethyl ester functional group, contributing to its reactivity and solubility properties. The thiazole moiety is known for its biological activity, often found in various natural products and pharmaceuticals. Ethyl 2-(1-methylethyl)-5-thiazolecarboxylate may exhibit characteristics such as moderate polarity, making it soluble in organic solvents while having limited solubility in water. Its structure suggests potential applications in medicinal chemistry, particularly in the development of bioactive compounds. Additionally, the presence of the isopropyl group (1-methylethyl) may influence its steric properties and reactivity. Overall, this compound represents a class of thiazole derivatives that could be of interest for further research in synthetic and medicinal chemistry.
Formula:C9H13NO2S
InChI:InChI=1S/C9H13NO2S/c1-4-12-9(11)7-5-10-8(13-7)6(2)3/h5-6H,4H2,1-3H3
InChI key:InChIKey=HHLQEQWHWROTMX-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C=1SC(C(C)C)=NC1
Synonyms:- 5-Thiazolecarboxylic acid, 2-(1-methylethyl)-, ethyl ester
- Ethyl 2-(1-methylethyl)-5-thiazolecarboxylate
- Ethyl 2-isopropylthiazole-5-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.