CAS 1655-68-1
:1-Methoxy-3-phenoxybenzene
Description:
1-Methoxy-3-phenoxybenzene, also known as an ether compound, is characterized by its aromatic structure, which includes a methoxy group (-OCH3) and a phenoxy group (-O-C6H5) attached to a benzene ring. This compound typically exhibits a colorless to pale yellow liquid form and is known for its moderate solubility in organic solvents while being less soluble in water due to its hydrophobic nature. Its molecular structure contributes to its potential applications in various fields, including organic synthesis and as an intermediate in the production of agrochemicals or pharmaceuticals. The presence of both methoxy and phenoxy groups can influence its reactivity, making it a candidate for electrophilic substitution reactions. Additionally, 1-Methoxy-3-phenoxybenzene may exhibit specific physical properties such as a distinct boiling point and melting point, which are influenced by intermolecular forces like van der Waals interactions. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C13H12O2
InChI:InChI=1/C13H12O2/c1-14-12-8-5-9-13(10-12)15-11-6-3-2-4-7-11/h2-10H,1H3
InChI key:InChIKey=CBVXNDCIOLXDFD-UHFFFAOYSA-N
SMILES:O(C1=CC(OC)=CC=C1)C2=CC=CC=C2
Synonyms:- 1-Methoxy-3-Phenoxybenzene
- 3-Methoxydiphenyl ether
- 3-Methoxyphenoxybenzene
- 3-Phenoxyanisole
- Benzene, 1-methoxy-3-phenoxy-
- NSC 57097
- m-Methoxyphenyl phenyl ether
- m-Phenoxymethoxybenzene
- m-Phenoxyphenol monomethyl ether
- Phenyl(3-methoxyphenyl) ether
- N-Phenyl-bis(trifluoromethylsulfonamide)
- 3-Phenoxyanisole,97%
- m-phenoxyanisole
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
3-Phenoxyanisole, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C13H12O2Purity:97%Color and Shape:Clear colorless, LiquidMolecular weight:200.233-Phenoxyanisole
CAS:3-Phenoxyanisole is a bioactive chemical.Formula:C13H12O2Color and Shape:SolidMolecular weight:200.23


