CAS 16552-65-1

5-Isoquinolinamine,4-bromo-(9CI)

Description:

5-Isoquinolinamine, 4-bromo- (9CI), with the CAS number 16552-65-1, is a chemical compound characterized by its isoquinoline structure, which is a bicyclic aromatic compound. This substance features a bromine atom substituted at the fourth position of the isoquinoline ring and an amino group at the fifth position, contributing to its reactivity and potential biological activity. The presence of the bromine atom can enhance the compound's lipophilicity and influence its interaction with biological targets. Typically, compounds of this nature may exhibit properties such as antimicrobial, anticancer, or other pharmacological activities, making them of interest in medicinal chemistry. The molecular structure allows for various synthetic modifications, which can lead to derivatives with altered properties. Additionally, the compound's solubility, stability, and reactivity can vary based on the surrounding conditions, such as pH and solvent polarity. Overall, 5-Isoquinolinamine, 4-bromo- is a significant compound in the study of organic chemistry and drug development.

Formula: C₉H₇BrN₂

InChI: InChI=1/C9H7BrN2/c10-7-5-12-4-6-2-1-3-8(11)9(6)7/h1-5H,11H2

SMILES: c1cc2cncc(c2c(c1)N)Br

Synonyms:

• 4-Bromoisoquinolin-5-amine
• 5-Isoquinolinamine, 4-Bromo-

4-Bromo-isoquinolin-5-ylamine

CAS: 16552-65-1

Formula: C₉H₇BrN₂

Purity: 96%

Color and Shape: Solid

Molecular weight: 223.0693

Ref: IN-DA001W75

4-Bromoisoquinolin-5-amine

CAS: 16552-65-1

4-Bromoisoquinolin-5-amine

Purity: 96%

Molecular weight: 223.07g/mol

Ref: 54-OR76386

5-AMINO-4-BROMOISOQUINOLINE

CAS: 16552-65-1

Formula: C₉H₇BrN₂

Purity: 96%

Molecular weight: 223.073

Ref: 10-F300680

4-bromoisoquinolin-5-amine

CAS: 16552-65-1

Versatile small molecule scaffold

Formula: C₉H₇BrN₂

Purity: Min. 95%

Molecular weight: 223.1 g/mol

Ref: 3D-RAA55265