CAS 165524-85-6
:6-O-Benzyl-D-glucal
Description:
6-O-Benzyl-D-glucal is a chemical compound that belongs to the class of glucals, which are unsaturated derivatives of glucose. This substance is characterized by the presence of a benzyl group at the 6-position of the glucal structure, which contributes to its unique reactivity and properties. The compound typically exhibits a white to off-white crystalline appearance and is soluble in organic solvents such as methanol and dichloromethane, but has limited solubility in water due to its hydrophobic benzyl substituent. 6-O-Benzyl-D-glucal is of interest in organic synthesis and carbohydrate chemistry, particularly for its potential use as a glycosyl donor in glycosylation reactions. Its unsaturated nature allows for further functionalization, making it a valuable intermediate in the synthesis of various glycosides and other carbohydrate derivatives. Additionally, the compound may exhibit biological activity, although specific pharmacological properties would require further investigation. Overall, 6-O-Benzyl-D-glucal serves as an important building block in the field of synthetic organic chemistry.
Formula:C13H16O4
InChI:InChI=1/C13H16O4/c14-11-6-7-17-12(13(11)15)9-16-8-10-4-2-1-3-5-10/h1-7,11-15H,8-9H2/t11-,12-,13+/m1/s1
Synonyms:- 1,5-anhydro-6-O-benzyl-2-deoxy-D-arabino-hex-1-enitol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
D-arabino-Hex-1-enitol, 1,5-anhydro-2-deoxy-6-O-(phenylmethyl)-
CAS:Formula:C13H16O4Molecular weight:236.26376-O-Benzyl-D-glucal
CAS:6-O-Benzyl-D-glucal is an Oligosaccharide, Carbohydrate, complex carbohydrate. It is a custom synthesis of 6-O-benzylated D-glucal. This product is synthesized by the methylation and glycosylation of D-glucose. The molecular weight of this product ranges from 300 to 500 Da. It is also a synthetic compound that can be used in the modification of oligosaccharides and polysaccharides. 6-O-Benzyl-D-glucal has high purity, which can be confirmed by analyzing its melting point and IR spectrum. The CAS number for this product is 1655248566. It reacts with fluoride to produce fluorinated saccharide products that are soluble in water or organic solvents.Formula:C13H16O4Purity:Min. 95%Molecular weight:236.26 g/mol


