CAS 165524-90-3

3,6-Di-O-acetyl-4-O-benzyl-D-galactal

Description:

3,6-Di-O-acetyl-4-O-benzyl-D-galactal is a synthetic carbohydrate derivative, specifically a galactose derivative modified with acetyl and benzyl groups. This compound features two acetyl groups at the 3 and 6 positions and a benzyl group at the 4 position of the galactose sugar. The presence of these functional groups enhances its solubility and reactivity, making it useful in various chemical reactions and applications, particularly in organic synthesis and carbohydrate chemistry. The acetyl groups can be hydrolyzed under specific conditions, allowing for the regeneration of hydroxyl groups, which can participate in further chemical transformations. Additionally, the benzyl group can serve as a protecting group or a point of attachment for other chemical entities. This compound may also exhibit biological activity, as many carbohydrate derivatives play roles in cell recognition and signaling processes. Overall, 3,6-Di-O-acetyl-4-O-benzyl-D-galactal is a versatile compound with potential applications in both research and industry.

Formula: C₁₇H₂₀O₆

InChI: InChI=1/C17H20O6/c1-12(18)21-11-16-17(15(8-9-20-16)23-13(2)19)22-10-14-6-4-3-5-7-14/h3-9,15-17H,10-11H2,1-2H3/t15-,16-,17-/m1/s1

Synonyms:

• 1,4-di-O-acetyl-2,6-anhydro-3-O-benzyl-5-deoxy-D-arabino-hex-5-enitol

3,6-Di-O-acetyl-4-O-benzyl-D-galactal

CAS: 165524-90-3

3,6-Di-O-acetyl-4-O-benzyl-D-galactal is a custom synthesis of a polysaccharide. It is modified with fluorination, methylation, and click chemistry. The final product contains a glycosyl group that has been modified with an acetyl group. This modification occurs at the C3 position of the sugar unit. The CAS number for this compound is 165524-90-3.

Formula: C₁₇H₂₀O₆

Purity: Min. 95%

Molecular weight: 320.35 g/mol

Ref: 3D-MD07470