CAS 165547-79-5
:4-Chloro-3-nitro-2-pyridone
Description:
4-Chloro-3-nitro-2-pyridone is an organic compound characterized by its pyridine ring, which is substituted at the 2-position with a hydroxyl group, at the 3-position with a nitro group, and at the 4-position with a chlorine atom. This compound typically appears as a solid and is known for its potential applications in pharmaceuticals and agrochemicals due to its bioactive properties. The presence of the nitro and chloro substituents contributes to its reactivity and may influence its solubility and stability in various solvents. It is important to handle this compound with care, as it may exhibit toxicity or environmental hazards. The molecular structure allows for various chemical reactions, making it a valuable intermediate in synthetic organic chemistry. Additionally, its unique functional groups can participate in hydrogen bonding and other intermolecular interactions, which can affect its physical properties such as melting point and boiling point. Overall, 4-Chloro-3-nitro-2-pyridone is a significant compound in the realm of chemical research and development.
Formula:C5H3ClN2O3
InChI:InChI=1/C5H3ClN2O3/c6-3-1-2-7-5(9)4(3)8(10)11/h1-2H,(H,7,9)
SMILES:c1cnc(c(c1Cl)N(=O)=O)O
Synonyms:- 4-Chloro-2-hydroxy-3-nitropyridine
- 4-chloro-3-nitropyridin-2(1H)-one
- 4-Chloro-3-Nitropyridin-2-Ol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-Chloro-3-nitro-2-pyridone, 98%
CAS:4-Chloro-3-nitro-2-pyridone finds an important application as raw material in organic synthesis and pharmaceuticals. It is also used as an intermediate in agrochemicals and dyestuffs. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documeFormula:C5H3ClN2O3Purity:98%Color and Shape:Yellow, PowderMolecular weight:174.542(1H)-Pyridinone, 4-chloro-3-nitro-
CAS:Formula:C5H3ClN2O3Purity:98%Color and Shape:SolidMolecular weight:174.54194-Chloro-3-nitro-2-pyridone
CAS:4-Chloro-3-nitro-2-pyridoneFormula:C5H3ClN2O3Purity:98%Color and Shape: yellow solidMolecular weight:174.54g/mol4-Chloro-2-hydroxy-3-nitropyridine
CAS:Formula:C5H3ClN2O3Purity:98%Color and Shape:SolidMolecular weight:174.54



