CAS 16555-77-4
:2-Hydroxyhippuric acid
Description:
2-Hydroxyhippuric acid is an aromatic compound characterized by its structure, which includes a benzene ring, a carboxylic acid group, and a hydroxyl group. It is a derivative of hippuric acid, formed through the conjugation of benzoic acid with glycine, and is notable for its role in the metabolism of certain aromatic compounds in the body. This compound is typically found in urine as a metabolite, particularly after the ingestion of substances like toluene or other aromatic hydrocarbons. In terms of solubility, 2-hydroxyhippuric acid is generally soluble in water due to its polar functional groups, which enhance its interaction with water molecules. Its presence in biological fluids can serve as a biomarker for exposure to specific environmental pollutants. Additionally, it may exhibit various biological activities, although its specific pharmacological effects are less well-documented compared to other metabolites. Overall, 2-hydroxyhippuric acid is significant in both toxicology and environmental chemistry, reflecting the body's processing of xenobiotic substances.
Formula:C9H9NO4
InChI:InChI=1S/C9H9NO4/c11-7(10-8(12)9(13)14)6-4-2-1-3-5-6/h1-5,8,12H,(H,10,11)(H,13,14)
InChI key:InChIKey=GCWCVCCEIQXUQU-UHFFFAOYSA-N
SMILES:C(NC(C(O)=O)O)(=O)C1=CC=CC=C1
Synonyms:- (2R)-hydroxy[(phenylcarbonyl)amino]ethanoate
- (2S)-hydroxy[(phenylcarbonyl)amino]ethanoate
- (Benzoylamino)(Hydroxy)Acetic Acid
- 2-(Benzoylamino)-2-hydroxyacetic acid
- 2-Benzamido-2-hydroxyacetic acid
- 2-Benzamido-2-hydroxyaceticacid
- 2-Hydroxy-2-(phenylformamido)acetic acid
- Acetic acid, (benzoylamino)hydroxy-
- Acetic acid, 2-(benzoylamino)-2-hydroxy-
- Benzamidohydroxyacetic acid
- Hippuric acid, α-hydroxy-
- N-(2-hydroxybenzoyl)glycine
- Salicylglycine
- [(Benzoylamino)Oxy]Acetic Acid
- alpha-Hydroxybenzoylglycine
- alpha-Hydroxyhippuric acid
- {[(2-Hydroxyphenyl)Carbonyl]Amino}Acetate
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Acetic acid, 2-(benzoylamino)-2-hydroxy-
CAS:Formula:C9H9NO4Purity:95%Color and Shape:SolidMolecular weight:195.17212-Benzamido-2-Hydroxyacetic Acid
CAS:2-Benzamido-2-Hydroxyacetic AcidPurity:99%Molecular weight:195.17g/molalpha-Hydroxyhippuric acid
CAS:Alpha-hydroxyhippuric acid (AHA) is a metabolite of benzoic acid. It is the end product of the hydrolysis of the benzyl ester linkage in metoprolol succinate, and it can be detected in urine samples. AHA is a diagnostic marker for renal dysfunction and nephrology dialysis. The reaction mechanism for AHA formation is not known, but it may involve gamma-aminobutyric acid (GABA), which has been shown to inhibit carboxylesterase activity. In addition to being used as an indicator of renal function, AHA has also been used as a probe for gamma-aminobutyric acid receptors. AHA has been shown to bind to thiophosphorylcholine (TPC) better than other amino acids, such as glycine or glutamic acid. This binding leads to conformational changes that are critical for TPC function and protein stability.Formula:C9H9NO4Purity:Min. 95%Color and Shape:PowderMolecular weight:195.17 g/mol



