CAS 1656-44-6
:2,4-Dinitrobenzenesulfonyl chloride
Description:
2,4-Dinitrobenzenesulfonyl chloride, with the CAS number 1656-44-6, is a chemical compound characterized by its sulfonyl chloride functional group and two nitro groups positioned on a benzene ring. This compound is typically a yellow crystalline solid that is soluble in organic solvents such as dichloromethane and acetone but is generally insoluble in water. It is known for its reactivity, particularly in nucleophilic substitution reactions, where it can act as a sulfonating agent. The presence of the nitro groups enhances its electrophilic character, making it useful in various synthetic applications, including the preparation of sulfonamides and other derivatives. Due to its reactive nature, it must be handled with care, as it can be corrosive and may pose health hazards upon exposure. Proper safety measures, including the use of personal protective equipment, are essential when working with this compound in a laboratory setting.
Formula:C6H3ClN2O6S
InChI:InChI=1S/C6H3ClN2O6S/c7-16(14,15)6-2-1-4(8(10)11)3-5(6)9(12)13/h1-3H
InChI key:InChIKey=SSFSNKZUKDBPIT-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C(S(Cl)(=O)=O)C=CC(N(=O)=O)=C1
Synonyms:- 2,4-Dinitrobenzene-1-sulfonyl chloride
- 2,4-Dinitrobenzenesulphonyl chloride
- 2,4-Dinitrophenylsulfonyl chloride
- Benzenesulfonyl chloride, 2,4-dinitro-
- 2,4-Dinitrobenzenesulfonyl chloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2,4-Dinitrobenzenesulfonyl chloride, 98%
CAS:<p>2,4-Dinitrobenzenesulfonyl chloride was used to protect primary amines. It was used as starting reagent in the synthesis of tert-butyl 2-[(2,4-dinitrophenyl) sulfonyl]amino acetate. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documenta</p>Formula:C6H3ClN2O6SPurity:98%Color and Shape:Crystals or powder or crystalline powder or granules, Cream to yellow to pale brownMolecular weight:266.612,4-Dinitrobenzenesulphonyl chloride
CAS:2,4-Dinitrobenzenesulphonyl chloridePurity:≥95%Color and Shape:SolidMolecular weight:266.62g/mol2,4-Dinitrobenzenesulfonyl chloride
CAS:Formula:C6H3ClN2O6SPurity:98.0%Color and Shape:SolidMolecular weight:266.612,4-Dinitrophenylsulfonyl Chloride
CAS:Controlled Product<p>Stability Hygroscopic<br>Applications 2,4-Dinitrophenylsulfonyl Chloride, can be used to protect primary amines. It is also used as starting material in the synthesis of tert-butyl 2-[(2,4-dinitrophenyl) sulfonyl]aminoacetate.<br>References Rachel J Ball et. al.: Artificial DNA, PNA & XNA, 1(1), undefined (2011-6-21);<br></p>Formula:C6H3ClN2O6SColor and Shape:Light YellowMolecular weight:266.622,4-Dinitrobenzenesulfonyl chloride
CAS:<p>2,4-Dinitrobenzenesulfonyl chloride is a chemical reagent that is used in analytical chemistry. It reacts with pyrazole rings to form 2-aminopyridine derivatives. The reaction can be enhanced by adding metal ions such as copper(II) or zinc(II). 2,4-Dinitrobenzenesulfonyl chloride is also used in the solid-phase synthesis of heterocycles and in the synthesis of pharmaceuticals. The compound has been shown to react with human serum and form an unstable intermediate that undergoes hydrolysis to produce sulfate ion and trifluoroacetic acid. This reaction mechanism can be applied to other nucleophilic compounds such as bromide ion. 2,4-Dinitrobenzenesulfonyl chloride reacts with the amine group of proteins using the S N 1 mechanism. The resulting product is a chlorinated amino acid derivative which exhibits fluorescence properties when reacted with</p>Formula:C6H3ClN2O6SPurity:Min. 95%Molecular weight:266.62 g/mol




