CymitQuimica logo

CAS 16560-43-3

:

4-IODOQUINOLINE

Description:
4-Iodoquinoline is an organic compound characterized by the presence of both a quinoline ring and an iodine substituent at the fourth position. Its molecular structure consists of a bicyclic aromatic system, which contributes to its stability and potential reactivity. The iodine atom enhances the compound's electrophilic properties, making it useful in various chemical reactions, including nucleophilic substitutions. 4-Iodoquinoline is typically a pale yellow to brown solid, and it is sparingly soluble in water but more soluble in organic solvents such as ethanol and dichloromethane. This compound is of interest in medicinal chemistry due to its potential biological activities, including antimicrobial and antitumor properties. Additionally, it can serve as a precursor for the synthesis of other functionalized quinoline derivatives. Safety precautions should be taken when handling this compound, as iodine-containing compounds can be hazardous. Overall, 4-iodoquinoline is a valuable compound in both research and industrial applications, particularly in the fields of organic synthesis and pharmaceuticals.
Formula:C9H6IN
InChI:InChI=1/C9H6IN/c10-8-5-6-11-9-4-2-1-3-7(8)9/h1-6H
InChI key:STERKHRCDZPNRE-UHFFFAOYSA-N
SMILES:c1ccc2c(c1)c(ccn2)I
Found 4 products.