CAS 165668-41-7: Indisulam
Description:Indisulam, with the CAS number 165668-41-7, is a small molecule that has garnered attention in the field of cancer research. It is classified as a sulfonamide compound and functions primarily as an antitumor agent. Indisulam exhibits its pharmacological effects by inhibiting the enzyme carbonic anhydrase, which plays a crucial role in various physiological processes, including pH regulation and ion transport. This inhibition can lead to altered cellular metabolism and growth inhibition in cancer cells. The compound has shown promise in preclinical studies and early-phase clinical trials, particularly in the treatment of solid tumors. Indisulam is typically administered intravenously and has a relatively short half-life, necessitating careful consideration of dosing regimens. Its safety profile and potential side effects are still under investigation, but like many chemotherapeutic agents, it may be associated with myelosuppression and gastrointestinal disturbances. Overall, Indisulam represents a novel approach in targeted cancer therapy, highlighting the ongoing efforts to develop effective treatments for malignancies.
Formula:C14H12ClN3O4S2
InChI:InChI=1S/C14H12ClN3O4S2/c15-12-8-17-14-11(12)2-1-3-13(14)18-24(21,22)10-6-4-9(5-7-10)23(16,19)20/h1-8,17-18H,(H2,16,19,20)
InChI key:InChIKey=SETFNECMODOHTO-UHFFFAOYSA-N
SMILES:O=S(=O)(N)C1=CC=C(C=C1)S(=O)(=O)NC2=CC=CC=3C(Cl)=CNC23
- Synonyms:
- 1,4-Benzenedisulfonamide, N-(3-chloro-1H-indol-7-yl)-
- 1,4-Benzenedisulfonamide, N<sup>1</sup>-(3-chloro-1H-indol-7-yl)-
- E 7070
- N-(3-Chloro-1H-indol-7-yl)-1,4-benzenedisulfonamide
- N-(3-chloro-1H-indol-7-yl)benzene-1,4-disulfonamide
- N<sup>1</sup>-(3-Chloro-1H-indol-7-yl)-1,4-benzenedisulfonamide
- 1,4-Benzenedisulfonamide, N1-(3-chloro-1H-indol-7-yl)-
- N1-(3-Chloro-1H-indol-7-yl)-1,4-benzenedisulfonamide
- Indisulam
