CAS 165669-35-2

7-Bromo-1H-Pyrrolo[2,3-C]Pyridine

Description:

7-Bromo-1H-Pyrrolo[2,3-C]Pyridine is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. The presence of a bromine atom at the 7-position enhances its reactivity, making it a valuable intermediate in organic synthesis and medicinal chemistry. This compound typically exhibits a pale yellow to brownish appearance and is soluble in organic solvents. Its molecular structure allows for potential interactions with biological targets, making it of interest in drug discovery and development. The compound's reactivity can be attributed to the electron-withdrawing nature of the bromine substituent, which can influence nucleophilic attack and other chemical transformations. Additionally, 7-Bromo-1H-Pyrrolo[2,3-C]Pyridine may exhibit interesting pharmacological properties, although specific biological activities would depend on further investigation. Safety data should be consulted before handling, as halogenated compounds can pose health risks. Overall, this compound represents a significant class of heterocycles with diverse applications in chemistry and pharmacology.

Formula: C₇H₅BrN₂

InChI: InChI=1/C7H5BrN2/c8-7-6-5(1-3-9-6)2-4-10-7/h1-4,9H

SMILES: c1c[nH]c2c1ccnc2Br

Synonyms:

• 1H-Pyrrolo[2,3-c]pyridine, 7-bromo-

1H-Pyrrolo[2,3-c]pyridine, 7-bromo-

CAS: 165669-35-2

Formula: C₇H₅BrN₂

Purity: 96%

Color and Shape: Solid

Molecular weight: 197.0320

Ref: IN-DA001WAK

7-Bromo-1h-pyrrolo[2,3-c]pyridine

CAS: 165669-35-2

7-Bromo-1h-pyrrolo[2,3-c]pyridine

Purity: 98%

Molecular weight: 197.03g/mol

Ref: 54-OR345276

7-Bromo-1H-pyrrolo[2,3-c]pyridine

CAS: 165669-35-2

Formula: C₇H₅BrN₂

Purity: 96%

Color and Shape: Solid

Molecular weight: 197.035

Ref: 10-F040499