CAS 16567-11-6
:8-Bromo-6-chloroquinoline
Description:
8-Bromo-6-chloroquinoline is a heterocyclic organic compound characterized by its quinoline structure, which consists of a fused benzene and pyridine ring. The presence of bromine and chlorine substituents at the 8 and 6 positions, respectively, enhances its reactivity and potential applications in various chemical reactions. This compound typically exhibits a pale yellow to brownish color and is soluble in organic solvents. It is known for its biological activity, particularly in medicinal chemistry, where it may serve as a scaffold for the development of pharmaceuticals, including antimicrobial and antitumor agents. The halogen substituents can influence the compound's electronic properties, making it a subject of interest in studies related to drug design and synthesis. Additionally, 8-bromo-6-chloroquinoline may participate in various chemical reactions, such as nucleophilic substitutions and coupling reactions, due to the presence of the halogen atoms. Safety precautions should be observed when handling this compound, as it may pose health risks and environmental hazards.
Formula:C9H5BrClN
InChI:InChI=1/C9H5BrClN/c10-8-5-7(11)4-6-2-1-3-12-9(6)8/h1-5H
SMILES:c1cc2cc(cc(c2nc1)Br)Cl
Synonyms:- Quinoline, 8-Bromo-6-Chloro-
- 8-Bromo-6-chloroquinolilne
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Quinoline, 8-bromo-6-chloro-
CAS:Formula:C9H5BrClNPurity:98%Color and Shape:SolidMolecular weight:242.49978-Bromo-6-chloroquinoline
CAS:8-Bromo-6-chloroquinoline (8BCQ) is a fluorescent dye that emits blue light. It has photophysical properties such as its emission, absorption, and fluorescence. 8BCQ is an isomeric compound that can be used to study the relationship between emission and absorption spectra. It has been shown to be a good mediator of cross-coupling reactions in the synthesis of heterocycles. 8BCQ has a high yield as it can be synthesized by heating dioxane with potassium carbonate and palladium chloride under pressure.Formula:C9H5BrClNPurity:Min. 95%Molecular weight:242.5 g/mol



