CymitQuimica logo

CAS 16567-13-8

:

6-bromo-8-chloroquinoline

Description:
6-Bromo-8-chloroquinoline is a heterocyclic organic compound characterized by a quinoline backbone, which consists of a fused benzene and pyridine ring. The presence of bromine and chlorine substituents at the 6 and 8 positions, respectively, significantly influences its chemical properties and reactivity. This compound typically exhibits a pale yellow to brownish color and is sparingly soluble in water but more soluble in organic solvents such as ethanol and dichloromethane. It is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its biological activity against various pathogens. The halogen substituents can enhance the compound's lipophilicity and influence its interaction with biological targets. Additionally, 6-bromo-8-chloroquinoline may undergo various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions, making it a versatile intermediate in organic synthesis. Safety precautions should be taken when handling this compound, as halogenated compounds can pose health risks and environmental concerns.
Formula:C9H5BrClN
InChI:InChI=1S/C9H5BrClN/c10-7-4-6-2-1-3-12-9(6)8(11)5-7/h1-5H
InChI key:InChIKey=BDEUOIMCEVFYET-UHFFFAOYSA-N
SMILES:ClC=1C2=C(C=C(Br)C1)C=CC=N2
Synonyms:
  • Quinoline, 6-bromo-8-chloro-
  • 6-Bromo-8-chloroquinoline
Found 4 products.