CAS 165670-57-5: 2-(1-Methyl-1-phenylethyl)-5-phenyl-2H-tetrazole

Description:2-(1-Methyl-1-phenylethyl)-5-phenyl-2H-tetrazole, identified by its CAS number 165670-57-5, is a chemical compound characterized by its tetrazole ring, which is a five-membered heterocyclic structure containing four nitrogen atoms and one carbon atom. This compound features a complex structure with multiple phenyl groups and a methyl-phenylethyl substituent, contributing to its potential as a versatile building block in organic synthesis. The presence of the tetrazole moiety often imparts unique properties, such as increased stability and potential bioactivity, making it of interest in pharmaceutical and materials science applications. The compound may exhibit various physical and chemical properties, including solubility in organic solvents, and may participate in diverse chemical reactions due to the reactivity of the tetrazole ring. Its specific applications and behavior would depend on the context of use, including potential interactions with biological systems or incorporation into larger molecular frameworks. Further studies would be necessary to elucidate its full range of characteristics and applications.

Formula:C₁₆H₁₆N₄

InChI:InChI=1S/C16H16N4/c1-16(2,14-11-7-4-8-12-14)20-18-15(17-19-20)13-9-5-3-6-10-13/h3-12H,1-2H3

InChI key:InChIKey=IRWNVNYVNZBWDD-UHFFFAOYSA-N

SMILES:N1=NN(N=C1C2=CC=CC=C2)C(C=3C=CC=CC3)(C)C

Synonyms:
2-Cumyl-5-phenyltetrazole
2H-tetrazole, 2-(1-methyl-1-phenylethyl)-5-phenyl-
5-Phenyl-2-(2-phenylpropan-2-yl)-2H-tetrazole
2-(1-Methyl-1-phenylethyl)-5-phenyl-2H-tetrazole

Found 3 products.

Product data	Purity	Price range	Estimated delivery
2H-Tetrazole, 2-(1-methyl-1-phenylethyl)-5-phenyl- REF: IN-DA001WAICAS: 165670-57-5	96%	To inquire	Tue 06 May 25
5-Phenyl-2-(2-phenylpropan-2-yl)-2H-tetrazole REF: 10-F230372CAS: 165670-57-5	95.0%	To inquire	Wed 14 May 25
5-Phenyl-2-(2-phenylpropan-2-yl)-2H-tetrazole REF: 3D-QGA67057CAS: 165670-57-5	Min. 95%	- - -	Discontinued product