CAS 165682-76-8
:2-[(2-Methylphenyl)amino]-4-thiazolecarboxylic acid
Description:
2-[(2-Methylphenyl)amino]-4-thiazolecarboxylic acid, with the CAS number 165682-76-8, is a chemical compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen. This compound features an amino group attached to a 2-methylphenyl moiety, contributing to its potential biological activity. The carboxylic acid functional group enhances its solubility in polar solvents and may influence its reactivity and interaction with biological systems. Typically, compounds of this nature may exhibit properties such as antimicrobial or anti-inflammatory activities, making them of interest in pharmaceutical research. The presence of the thiazole ring often suggests potential applications in medicinal chemistry due to its ability to participate in various chemical reactions and interactions. Additionally, the compound's structural features may allow for the formation of hydrogen bonds, influencing its binding affinity to biological targets. Overall, 2-[(2-Methylphenyl)amino]-4-thiazolecarboxylic acid represents a class of compounds that could be valuable in drug development and other chemical applications.
Formula:C11H10N2O2S
InChI:InChI=1S/C11H10N2O2S/c1-7-4-2-3-5-8(7)12-11-13-9(6-16-11)10(14)15/h2-6H,1H3,(H,12,13)(H,14,15)
InChI key:InChIKey=IUQPXTTVIWXDBO-UHFFFAOYSA-N
SMILES:N(C1=NC(C(O)=O)=CS1)C2=C(C)C=CC=C2
Synonyms:- 2-o-Tolylamino-thiazole-4-carboxylic acid
- 2-[(2-Methylphenyl)amino]-1,3-thiazole-4-carboxylic acid
- 2-[(2-Methylphenyl)amino]-4-thiazolecarboxylic acid
- 4-Thiazolecarboxylic acid, 2-[(2-methylphenyl)amino]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-o-Tolylamino-thiazole-4-carboxylic acid
CAS:Formula:C11H10N2O2SColor and Shape:SolidMolecular weight:234.27
