CAS 1657-32-5
:1-oxidopyridin-5-amine
Description:
1-Oxidopyridin-5-amine, with the CAS number 1657-32-5, is a heterocyclic organic compound featuring a pyridine ring substituted with an amino group and an oxygen atom. This compound is characterized by its nitrogen-containing aromatic structure, which contributes to its potential basicity and reactivity. The presence of the amino group (-NH2) enhances its ability to participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the oxidation state of the nitrogen in the pyridine ring can influence its electronic properties, making it a candidate for various applications in organic synthesis and medicinal chemistry. The compound may exhibit solubility in polar solvents due to the presence of the amino group, while its aromatic nature can provide stability and facilitate interactions with other molecules. Overall, 1-oxidopyridin-5-amine is of interest in research and development, particularly in the fields of pharmaceuticals and agrochemicals, where its unique structural features can be leveraged for the design of bioactive compounds.
Formula:C5H6N2O
InChI:InChI=1/C5H6N2O/c6-5-2-1-3-7(8)4-5/h1-4H,6H2
Synonyms:- pyridin-3-amine 1-oxide
- 3-Pyridinamine, 1-oxide
- NSC 60496
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

