CAS 165739-70-8

8-Chloro-3-methoxy-5,6-dihydro-11H-benzo[5,6]-cyclohepta[1,2-β]pyridin-11- one

Description:

8-Chloro-3-methoxy-5,6-dihydro-11H-benzo[5,6]-cyclohepta[1,2-β]pyridin-11-one, with the CAS number 165739-70-8, is a chemical compound characterized by its complex bicyclic structure, which includes a chloro substituent and a methoxy group. This compound belongs to a class of heterocyclic compounds, specifically pyridines, and features a fused ring system that contributes to its unique chemical properties. The presence of the chloro group typically enhances the compound's reactivity, while the methoxy group can influence its solubility and interaction with biological systems. The compound may exhibit various biological activities, making it of interest in medicinal chemistry and pharmacology. Its structural features suggest potential applications in drug development, particularly in targeting specific biological pathways. As with many heterocycles, the compound's stability, reactivity, and interactions with other molecules can be influenced by its electronic and steric properties, which are determined by the arrangement of atoms and functional groups within its structure.

Formula: C₁₅H₁₂ClNO₂

InChI: InChI=1/C15H12ClNO2/c1-19-12-7-10-3-2-9-6-11(16)4-5-13(9)15(18)14(10)17-8-12/h4-8H,2-3H2,1H3

SMILES: COc1cc2CCc3cc(ccc3C(=O)c2nc1)Cl

Synonyms:

• 8-chloro-3-methoxy-5,6-dihydro-11H-benzo[5,6]cyclohepta[1,2-b]pyridin-11-one

8-Chloro-3-methoxy-5,6-dihydro-11H-benzo[5,6]-cyclohepta[1,2-b]pyridin-11- one

Controlled Product

CAS: 165739-70-8

Applications 8-Chloro-3-methoxy-5,6-dihydro-11H-benzo[5,6]-cyclohepta[1,2-b]pyridin-11- one (cas# 165739-70-8) is a compound useful in organic synthesis.

Formula: C₁₅H₁₂ClNO₂

Color and Shape: Neat

Molecular weight: 273.71

Ref: TR-C367958