CAS 165739-72-0
:8-Chloro-6,11-dihydro-3-methoxy-11-(1-methyl-4-piperidinylidene)-5H-benzo[5,6]cyclohepta[1,2-b]pyridine
Description:
8-Chloro-6,11-dihydro-3-methoxy-11-(1-methyl-4-piperidinylidene)-5H-benzo[5,6]cyclohepta[1,2-b]pyridine, with CAS number 165739-72-0, is a synthetic organic compound characterized by its complex polycyclic structure, which includes a benzo-cycloheptapyridine framework. This compound features a chloro substituent and a methoxy group, contributing to its chemical reactivity and potential biological activity. The presence of a piperidine moiety suggests possible interactions with biological targets, making it of interest in medicinal chemistry. Its unique structure may impart specific pharmacological properties, potentially influencing its solubility, stability, and interaction with receptors or enzymes. The compound is likely to be studied for its therapeutic applications, particularly in the fields of neuropharmacology or as a potential drug candidate. As with many synthetic compounds, understanding its characteristics, including its synthesis, reactivity, and biological effects, is crucial for evaluating its utility in research and development. Safety and handling considerations are also important due to the presence of chlorine and other functional groups.
Formula:C21H23ClN2O
InChI:InChI=1S/C21H23ClN2O/c1-24-9-7-14(8-10-24)20-19-6-5-17(22)11-15(19)3-4-16-12-18(25-2)13-23-21(16)20/h5-6,11-13H,3-4,7-10H2,1-2H3
InChI key:InChIKey=ONYKRGLBQBBZDH-UHFFFAOYSA-N
SMILES:O(C)C=1C=C2C(C(C=3C(CC2)=CC(Cl)=CC3)=C4CCN(C)CC4)=NC1
Synonyms:- 8-Chloro-6,11-dihydro-3-methoxy-11-(1-methyl-4-piperidinylidene)-5H-benzo[5,6]cyclohepta[1,2-b]pyridine
- 5H-Benzo[5,6]cyclohepta[1,2-b]pyridine, 8-chloro-6,11-dihydro-3-methoxy-11-(1-methyl-4-piperidinylidene)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3-Methoxy-N-methyldesloratadine
CAS:Controlled ProductApplications 3-Methoxy-N-methyldesloratadine (cas# 165739-72-0) is a compound useful in organic synthesis.
Formula:C21H23ClN2OColor and Shape:NeatMolecular weight:354.87
