
CAS 165743-61-3
:1-(1,5-Diethyl-1H-pyrazol-3-yl)ethanone
Description:
1-(1,5-Diethyl-1H-pyrazol-3-yl)ethanone, with the CAS number 165743-61-3, is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. This compound features ethyl substituents at the 1 and 5 positions of the pyrazole ring, contributing to its unique chemical properties. The presence of the ethanone functional group indicates that it contains a carbonyl group (C=O) adjacent to the pyrazole moiety, which can influence its reactivity and potential applications in organic synthesis. Generally, compounds like this may exhibit biological activity, making them of interest in medicinal chemistry. The molecular structure suggests potential for hydrogen bonding and other intermolecular interactions, which can affect solubility and stability in various solvents. Additionally, the presence of the ethyl groups may enhance lipophilicity, influencing the compound's behavior in biological systems. Overall, this compound's characteristics make it a subject of interest for further research in both synthetic and applied chemistry contexts.
Formula:C9H14N2O
InChI:InChI=1S/C9H14N2O/c1-4-8-6-9(7(3)12)10-11(8)5-2/h6H,4-5H2,1-3H3
InChI key:InChIKey=CVSVOYOSJSDAGG-UHFFFAOYSA-N
SMILES:C(C)C=1N(CC)N=C(C(C)=O)C1
Synonyms:- 1-(1,5-Diethyl-1H-pyrazol-3-yl)ethan-1-one
- Ethanone, 1-(1,5-diethyl-1H-pyrazol-3-yl)-
- 1-(1,5-Diethyl-1H-pyrazol-3-yl)ethanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.