CAS 1658-08-8: 1,2,3,4,5,6,7,8-Octahydroacridine
Description:1,2,3,4,5,6,7,8-Octahydroacridine, with the CAS number 1658-08-8, is a bicyclic organic compound characterized by its saturated structure derived from acridine. This compound features a fused ring system that includes eight hydrogenated carbon atoms, resulting in a stable, non-aromatic configuration. It is typically a colorless to pale yellow liquid or solid, depending on its form and purity. The compound exhibits moderate polarity, which influences its solubility in various organic solvents. Its chemical properties include the potential for hydrogen bonding due to the presence of nitrogen in the acridine framework, which can affect its reactivity and interactions with other molecules. 1,2,3,4,5,6,7,8-Octahydroacridine is of interest in various fields, including medicinal chemistry and materials science, due to its structural similarity to biologically active compounds. Additionally, it may serve as a precursor or intermediate in the synthesis of more complex organic molecules. Safety data should be consulted for handling and usage, as with all chemical substances.
Formula:C13H17N
InChI:InChI=1S/C13H17N/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)14-12/h9H,1-8H2
InChI key:InChIKey=LLCXJIQXTXEQID-UHFFFAOYSA-N
SMILES:N=1C2=C(C=C3C1CCCC3)CCCC2
- Synonyms:
- Acridine, 1,2,3,4,5,6,7,8-octahydro-
- Octahydroacridine
- 1,2,3,4,5,6,7,8-Octahydroacridine

1,2,3,4,5,6,7,8-Octahydroacridine
Ref: 3B-O0197
5g | 214.00 € |

Acridine, 1,2,3,4,5,6,7,8-octahydro-
Ref: IN-DA001WCU
1g | 126.00 € | ||
5g | 255.00 € |

1,2,3,4,5,6,7,8-Octahydroacridine
Ref: 10-F635867
1g | 76.00 € | ||
5g | 200.00 € | ||
250mg | 39.00 € |

1,2,3,4,5,6,7,8-Octahydroacridine
Controlled ProductRef: TR-O148513
50mg | 92.00 € | ||
100mg | 111.00 € | ||
500mg | 266.00 € |

1,2,3,4,5,6,7,8 -Octahydroacridine
Ref: 3D-FO167718
1g | Discontinued | Request information | |
2g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
25g | Discontinued | Request information |