CAS 165807-06-7
:2-Amino-4-pyrimidinecarboxaldehyde
Description:
2-Amino-4-pyrimidinecarboxaldehyde is an organic compound characterized by its pyrimidine ring structure, which features an amino group and an aldehyde functional group. This compound is typically represented by the molecular formula C6H6N4O, indicating the presence of carbon, hydrogen, nitrogen, and oxygen atoms. The amino group (-NH2) contributes to its basicity and potential reactivity, while the aldehyde group (-CHO) allows for further chemical transformations, such as condensation reactions. 2-Amino-4-pyrimidinecarboxaldehyde is often utilized in the synthesis of various pharmaceuticals and agrochemicals due to its ability to serve as a building block in organic synthesis. Additionally, its structural features may impart biological activity, making it of interest in medicinal chemistry. The compound is usually handled with standard laboratory precautions, as with many nitrogen-containing heterocycles, due to potential toxicity and reactivity. Overall, 2-Amino-4-pyrimidinecarboxaldehyde is a versatile compound with applications in both research and industry.
Formula:C5H5N3O
InChI:InChI=1S/C5H5N3O/c6-5-7-2-1-4(3-9)8-5/h1-3H,(H2,6,7,8)
InChI key:InChIKey=JFGUYYUCZSRMCF-UHFFFAOYSA-N
SMILES:C(=O)C1=NC(N)=NC=C1
Synonyms:- 2-Amino-4-pyrimidinecarboxaldehyde
- 2-Aminopyrimidine-4-Carbaldehyde
- 2-Aminopyrimidine-4-carboxaldehyde
- 4-Pyrimidinecarboxaldehyde, 2-amino-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
