CAS 16583-13-4

2-Bromo-3,4,5,6-tetrafluorotoluene

Description:

2-Bromo-3,4,5,6-tetrafluorotoluene is an aromatic halogenated compound characterized by the presence of both bromine and fluorine substituents on a toluene ring. The molecular structure features a bromine atom at the second position and four fluorine atoms at the 3, 4, 5, and 6 positions of the aromatic ring, contributing to its unique chemical properties. This compound is typically a colorless to pale yellow liquid or solid, depending on temperature and purity. It exhibits high thermal stability and is relatively non-polar due to the presence of the fluorine atoms, which can influence its reactivity and solubility in various solvents. The presence of halogens generally enhances the compound's reactivity, making it useful in various chemical syntheses and applications, including as an intermediate in the production of pharmaceuticals and agrochemicals. Additionally, its fluorinated nature may impart specific characteristics such as increased lipophilicity and altered electronic properties, making it of interest in materials science and organic chemistry research.

Formula: C₇H₃BrF₄

InChI: InChI=1/C7H3BrF4/c1-2-3(8)5(10)7(12)6(11)4(2)9/h1H3

SMILES: Cc1c(c(c(c(c1F)F)F)F)Br

Synonyms:

• 1-Bromo-2,3,4,5-Tetrafluoro-6-Methylbenzene