CAS 16587-40-9

2,7-dimethyl-1-benzothiophene

Description:

2,7-Dimethyl-1-benzothiophene is an organic compound characterized by its fused ring structure, which consists of a benzene ring and a thiophene ring. This compound features two methyl groups attached to the benzothiophene framework at the 2 and 7 positions, contributing to its unique chemical properties. It is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. The presence of the thiophene ring imparts aromatic characteristics, making it relatively stable and resistant to oxidation. Its molecular structure allows for potential applications in organic electronics, as well as in the synthesis of various organic compounds. Additionally, 2,7-dimethyl-1-benzothiophene may exhibit interesting photophysical properties, making it a subject of study in materials science. However, specific reactivity and solubility characteristics can vary based on the environment and conditions, such as solvent polarity and temperature. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.

Formula: C₁₀H₁₀S

InChI: InChI=1/C10H10S/c1-7-4-3-5-9-6-8(2)11-10(7)9/h3-6H,1-2H3

SMILES: Cc1cccc2cc(C)sc12

Synonyms:

• 2,7-Dimethylbenzo[b]thiophene
• Benzo[b]thiophene, 2,7-dimethyl-

2,7-Dimethylbenzo[b]thiophene

CAS: 16587-40-9

Formula: C₁₀H₁₀S

Purity: 97%

Molecular weight: 162.2514

Ref: IN-DA00AZY6

2,7-Dimethylbenzo[b]thiophene

CAS: 16587-40-9

2,7-Dimethylbenzo[b]thiophene

Purity: 97%

Molecular weight: 162.25g/mol

Ref: 54-OR77962

2,7-Dimethylbenzo[b]thiophene

CAS: 16587-40-9

Purity: 97%

Molecular weight: 162.25

Ref: 10-F983403

2,7-Dimethyl-1-benzothiophene

CAS: 16587-40-9

Versatile small molecule scaffold

Formula: C₁₀H₁₀S

Purity: Min. 95%

Molecular weight: 162.25 g/mol

Ref: 3D-RAA58740